EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26N4O2S2 |
| Net Charge | 0 |
| Average Mass | 490.654 |
| Monoisotopic Mass | 490.14972 |
| SMILES | N[C@@H](CSSC[C@H](N)C(=O)Nc1ccc2ccccc2c1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H26N4O2S2/c27-23(25(31)29-21-11-9-17-5-1-3-7-19(17)13-21)15-33-34-16-24(28)26(32)30-22-12-10-18-6-2-4-8-20(18)14-22/h1-14,23-24H,15-16,27-28H2,(H,29,31)(H,30,32)/t23-,24-/m0/s1 |
| InChIKey | REEVAJUPLLWYBH-ZEQRLZLVSA-N |
| Roles Classification |
|---|
| Application: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-cystine di-2-naphthylamide (CHEBI:90428) has functional parent L-cystine (CHEBI:16283) |
| L-cystine di-2-naphthylamide (CHEBI:90428) has role chromogenic compound (CHEBI:75050) |
| L-cystine di-2-naphthylamide (CHEBI:90428) is a N-(2-naphthyl)carboxamide (CHEBI:88330) |
| L-cystine di-2-naphthylamide (CHEBI:90428) is a L-cysteine derivative (CHEBI:83824) |
| L-cystine di-2-naphthylamide (CHEBI:90428) is a amino acid amide (CHEBI:22475) |
| L-cystine di-2-naphthylamide (CHEBI:90428) is a dicarboxylic acid diamide (CHEBI:35779) |
| L-cystine di-2-naphthylamide (CHEBI:90428) is a organic disulfide (CHEBI:35489) |
| IUPAC Name |
|---|
| N,N'-dinaphthalen-2-yl-L-cystinamide |
| Synonyms | Source |
|---|---|
| L-cysteine di-β-naphthylamide | ChEBI |
| L-cystine bis[N-(β-naphthyl)amide] | ChEBI |
| L-cystine bis[N-(2-naphthyl)amide] | ChEBI |
| N,N'-di-2-naphthyl-L-cystinediamide | ChEBI |
| Cystine-di-beta-naphthylamide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3183259 | Reaxys |
| CAS:1259-69-4 | ChemIDplus |
| Citations |
|---|