EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17376 - cystine
| Formula | C6H12N2O4S2 |
| Net Charge | 0 |
| Average Mass | 240.306 |
| Monoisotopic Mass | 240.02385 |
| SMILES | NC(CSSCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12) |
| InChIKey | LEVWYRKDKASIDU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cystine (CHEBI:17376) has role human metabolite (CHEBI:77746) |
| cystine (CHEBI:17376) has role mouse metabolite (CHEBI:75771) |
| cystine (CHEBI:17376) is a cysteine derivative (CHEBI:23509) |
| cystine (CHEBI:17376) is a organic disulfide (CHEBI:35489) |
| cystine (CHEBI:17376) is a sulfur-containing amino acid (CHEBI:26834) |
| cystine (CHEBI:17376) is tautomer of cystine zwitterion (CHEBI:35492) |
| Incoming Relation(s) |
| Cys-Gly disulfide (CHEBI:133040) has functional parent cystine (CHEBI:17376) |
| D-cystine (CHEBI:35494) is a cystine (CHEBI:17376) |
| L-cystine (CHEBI:16283) is a cystine (CHEBI:17376) |
| cystine residue (CHEBI:50051) is substituent group from cystine (CHEBI:17376) |
| cystinyl group (CHEBI:50050) is substituent group from cystine (CHEBI:17376) |
| cystyl group (CHEBI:23514) is substituent group from cystine (CHEBI:17376) |
| cystine zwitterion (CHEBI:35492) is tautomer of cystine (CHEBI:17376) |
| IUPAC Names |
|---|
| 3,3'-disulfanediylbis(2-aminopropanoic acid) |
| cystine |
| Synonyms | Source |
|---|---|
| 3,3'-dithiobis(2-aminopropanoic acid) | ChEBI |
| alpha-Diamino-beta-dithiolactic acid | KEGG COMPOUND |
| cistina | ChEBI |
| Cystin | ChEBI |
| Cystine | KEGG COMPOUND |
| Dicysteine | KEGG COMPOUND |
| Citations |
|---|