EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:35494 - D-cystine
| Formula | C6H12N2O4S2 |
| Net Charge | 0 |
| Average Mass | 240.306 |
| Monoisotopic Mass | 240.02385 |
| SMILES | N[C@H](CSSC[C@@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m1/s1 |
| InChIKey | LEVWYRKDKASIDU-QWWZWVQMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.2.1.11 (aspartate-semialdehyde dehydrogenase) inhibitor Any EC 1.2.1.* (oxidoreductase acting on donor aldehyde/oxo group with NAD+ or NADP+ as acceptor) inhibitor that inhibits the action of aspartate-semialdehyde dehydrogenase (EC 1.2.1.11). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-cystine (CHEBI:35494) has role EC 1.2.1.11 (aspartate-semialdehyde dehydrogenase) inhibitor (CHEBI:145814) |
| D-cystine (CHEBI:35494) is a cystine (CHEBI:17376) |
| D-cystine (CHEBI:35494) is enantiomer of L-cystine (CHEBI:16283) |
| D-cystine (CHEBI:35494) is tautomer of D-cystine zwitterion (CHEBI:145813) |
| Incoming Relation(s) |
| L-cystine (CHEBI:16283) is enantiomer of D-cystine (CHEBI:35494) |
| D-cystine residue (CHEBI:50065) is substituent group from D-cystine (CHEBI:35494) |
| D-cystyl group (CHEBI:50049) is substituent group from D-cystine (CHEBI:35494) |
| D-cystine zwitterion (CHEBI:145813) is tautomer of D-cystine (CHEBI:35494) |
| IUPAC Names |
|---|
| D-cystine |
| (2S,2'S)-3,3'-disulfanediylbis(2-aminopropanoic acid) |
| Synonyms | Source |
|---|---|
| (2S,2'S)-3,3'-dithiobis(2-aminopropanoic acid) | ChEBI |
| cystine D-form | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728093 | Reaxys |
| CAS:349-46-2 | ChemIDplus |
| Citations |
|---|