EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO |
| Net Charge | 0 |
| Average Mass | 137.182 |
| Monoisotopic Mass | 137.08406 |
| SMILES | NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C8H11NO/c9-6-5-7-1-3-8(10)4-2-7/h1-4,10H,5-6,9H2 |
| InChIKey | DZGWFCGJZKJUFP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Solanum campaniforme (IPNI:818569-1) | leaf (BTO:0000713) | PubMed (21962208) | Dried leaves were extracted with ethyl alcohol. |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyramine (CHEBI:15760) has role Escherichia coli metabolite (CHEBI:76971) |
| tyramine (CHEBI:15760) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| tyramine (CHEBI:15760) has role human metabolite (CHEBI:77746) |
| tyramine (CHEBI:15760) has role mouse metabolite (CHEBI:75771) |
| tyramine (CHEBI:15760) has role neurotransmitter (CHEBI:25512) |
| tyramine (CHEBI:15760) is a monoamine molecular messenger (CHEBI:25375) |
| tyramine (CHEBI:15760) is a primary amino compound (CHEBI:50994) |
| tyramine (CHEBI:15760) is a tyramines (CHEBI:27175) |
| tyramine (CHEBI:15760) is conjugate base of tyraminium (CHEBI:327995) |
| Incoming Relation(s) |
| N-trans-cinnamoyltyramine (CHEBI:177872) has functional parent tyramine (CHEBI:15760) |
| N-acetyltyramine (CHEBI:125610) has functional parent tyramine (CHEBI:15760) |
| N-butanoyltyramine (CHEBI:166900) has functional parent tyramine (CHEBI:15760) |
| N-hexanoyltyramine (CHEBI:166901) has functional parent tyramine (CHEBI:15760) |
| N-sinapoyltyramine (CHEBI:234327) has functional parent tyramine (CHEBI:15760) |
| N,O-dimethyltyramine (CHEBI:75143) has functional parent tyramine (CHEBI:15760) |
| 3-nitrotyramine (CHEBI:71233) has functional parent tyramine (CHEBI:15760) |
| norbelladine (CHEBI:80666) has functional parent tyramine (CHEBI:15760) |
| tyramine phosphate (CHEBI:142808) has functional parent tyramine (CHEBI:15760) |
| tyramine sulfate (CHEBI:133530) has functional parent tyramine (CHEBI:15760) |
| γ-glutamyltyramine (CHEBI:84215) has functional parent tyramine (CHEBI:15760) |
| tyraminium (CHEBI:327995) is conjugate acid of tyramine (CHEBI:15760) |
| IUPAC Name |
|---|
| 4-(2-aminoethyl)phenol |
| Synonyms | Source |
|---|---|
| 2-(p-Hydroxyphenyl)ethylamine | KEGG COMPOUND |
| 4-Hydroxy-beta-phenylethylamine | HMDB |
| 4-hydroxyphenethylamine | ChEBI |
| 4-Hydroxyphenylethylamine | HMDB |
| beta-(4-Hydroxyphenyl)ethylamine | HMDB |
| p-(2-aminoethyl)phenol | ChEBI |
| Citations |
|---|