EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO |
| Net Charge | 0 |
| Average Mass | 165.236 |
| Monoisotopic Mass | 165.11536 |
| SMILES | CNCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C10H15NO/c1-11-8-7-9-3-5-10(12-2)6-4-9/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | JCMWSVNNSPUNER-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,O-dimethyltyramine (CHEBI:75143) has functional parent N-methyltyramine (CHEBI:17458) |
| N,O-dimethyltyramine (CHEBI:75143) has functional parent 4-methoxyphenylethylamine (CHEBI:266039) |
| N,O-dimethyltyramine (CHEBI:75143) has functional parent tyramine (CHEBI:15760) |
| N,O-dimethyltyramine (CHEBI:75143) has role metabolite (CHEBI:25212) |
| N,O-dimethyltyramine (CHEBI:75143) is a aromatic ether (CHEBI:35618) |
| N,O-dimethyltyramine (CHEBI:75143) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| compound 48/80 (CHEBI:75295) has functional parent N,O-dimethyltyramine (CHEBI:75143) |
| IUPAC Name |
|---|
| 2-(4-methoxyphenyl)-N-methylethanamine |
| Synonyms | Source |
|---|---|
| p-methoxy-N-methylphenethylamine | ChemIDplus |
| 4-methoxy-N-methylphenethylamine | ChEBI |
| 4-methoxy-N-methylbenzeneethanamine | ChemIDplus |
| N-(4-methoxyphenethyl)methylamine | ChEBI |
| N-(p-methoxyphenethyl)methylamine | ChemIDplus |
| N-methyl-p-methoxyphenethylamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2413387 | Reaxys |
| CAS:4091-50-3 | ChemIDplus |
| Citations |
|---|