EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O4 |
| Net Charge | 0 |
| Average Mass | 266.297 |
| Monoisotopic Mass | 266.12666 |
| SMILES | N[C@@H](CCC(=O)NCCc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C13H18N2O4/c14-11(13(18)19)5-6-12(17)15-8-7-9-1-3-10(16)4-2-9/h1-4,11,16H,5-8,14H2,(H,15,17)(H,18,19)/t11-/m0/s1 |
| InChIKey | ICIIWGMCNMZIQX-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Methanocaldococcus jannaschii (ncbitaxon:2190) | - | PubMed (24977328) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-glutamyltyramine (CHEBI:84215) has functional parent tyramine (CHEBI:15760) |
| γ-glutamyltyramine (CHEBI:84215) has role bacterial metabolite (CHEBI:76969) |
| γ-glutamyltyramine (CHEBI:84215) is a L-glutamine derivative (CHEBI:24317) |
| γ-glutamyltyramine (CHEBI:84215) is a dicarboxylic acid monoamide (CHEBI:35735) |
| γ-glutamyltyramine (CHEBI:84215) is tautomer of γ-glutamyltyramine zwitterion (CHEBI:83425) |
| Incoming Relation(s) |
| γ-glutamyltyramine zwitterion (CHEBI:83425) is tautomer of γ-glutamyltyramine (CHEBI:84215) |
| IUPAC Name |
|---|
| N-[2-(4-hydroxyphenyl)ethyl]-L-glutamine |
| Synonyms | Source |
|---|---|
| N-(γ-glutamyl)tyramine | ChEBI |
| N-(γ-L-glutamyl)tyramine | ChEBI |
| γ-L-glutamyltyramine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-17179 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6224260 | Reaxys |
| Citations |
|---|