EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N2O3 |
| Net Charge | 0 |
| Average Mass | 182.179 |
| Monoisotopic Mass | 182.06914 |
| SMILES | NCCc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H10N2O3/c9-4-3-6-1-2-8(11)7(5-6)10(12)13/h1-2,5,11H,3-4,9H2 |
| InChIKey | IUCYCHQMRZWPGT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-nitrotyramine (CHEBI:71233) has functional parent tyramine (CHEBI:15760) |
| 3-nitrotyramine (CHEBI:71233) is a 2-nitrophenols (CHEBI:86421) |
| 3-nitrotyramine (CHEBI:71233) is a tyramines (CHEBI:27175) |
| 3-nitrotyramine (CHEBI:71233) is tautomer of 3-nitrotyramine zwitterion (CHEBI:71286) |
| Incoming Relation(s) |
| 3-nitrotyramine zwitterion (CHEBI:71286) is tautomer of 3-nitrotyramine (CHEBI:71233) |
| IUPAC Name |
|---|
| 4-(2-aminoethyl)-2-nitrophenol |
| Synonyms | Source |
|---|---|
| 1-amino-2-(3-nitro-4-hydroxyphenyl)ethane | ChEBI |
| 4-hydroxy-3-nitrophenethylamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2837315 | Reaxys |
| Citations |
|---|