EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12NO |
| Net Charge | +1 |
| Average Mass | 138.190 |
| Monoisotopic Mass | 138.09134 |
| SMILES | [NH3+]CCc1ccc(O)cc1 |
| InChI | InChI=1S/C8H11NO/c9-6-5-7-1-3-8(10)4-2-7/h1-4,10H,5-6,9H2/p+1 |
| InChIKey | DZGWFCGJZKJUFP-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyraminium (CHEBI:327995) has role human metabolite (CHEBI:77746) |
| tyraminium (CHEBI:327995) has role neurotransmitter (CHEBI:25512) |
| tyraminium (CHEBI:327995) is a ammonium ion derivative (CHEBI:35274) |
| tyraminium (CHEBI:327995) is a monoamine molecular messenger (CHEBI:25375) |
| tyraminium (CHEBI:327995) is conjugate acid of tyramine (CHEBI:15760) |
| Incoming Relation(s) |
| tyramine (CHEBI:15760) is conjugate base of tyraminium (CHEBI:327995) |
| IUPAC Name |
|---|
| 2-(4-hydroxyphenyl)ethanaminium |
| Synonyms | Source |
|---|---|
| tyraminium(1+) | ChEBI |
| tyraminium cation | ChEBI |
| UniProt Name | Source |
|---|---|
| tyramine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| TYRAMINE | MetaCyc |