EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | [H][C@@]12/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC[C@]1([H])C2(C)C |
| InChI | InChI=1S/C20H32/c1-15-8-6-10-16(2)12-13-18-19(20(18,4)5)14-17(3)11-7-9-15/h9-10,14,18-19H,6-8,11-13H2,1-5H3/b15-9+,16-10+,17-14+/t18-,19+/m0/s1 |
| InChIKey | ZJMVJDFTNPZVMB-UNUVTCOTSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-casbene (CHEBI:157595) is a casbene (CHEBI:17695) |
| Incoming Relation(s) |
| 4-hydroxy-8-oxocasbene (CHEBI:156579) is a (−)-casbene (CHEBI:157595) |
| 4-hydroxycasbene (CHEBI:156578) is a (−)-casbene (CHEBI:157595) |
| 4,5,8-trihydroxycasbene (CHEBI:157602) is a (−)-casbene (CHEBI:157595) |
| 4,8-dihydroxycasbene (CHEBI:157601) is a (−)-casbene (CHEBI:157595) |
| 5,8-dihydroxy-4-oxocasbene (CHEBI:157604) is a (−)-casbene (CHEBI:157595) |
| 8-hydroxycasbene (CHEBI:157600) is a (−)-casbene (CHEBI:157595) |
| 8-oxocasbene (CHEBI:156572) is a (−)-casbene (CHEBI:157595) |
| IUPAC Name |
|---|
| (1S,2R,3E,7E,11E)-4,8,12,15,15-pentamethylbicyclo[12.1.0]pentadeca-3,7,11-triene |
| UniProt Name | Source |
|---|---|
| (−)-casbene | UniProt |
| Citations |
|---|