EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H][C@@]12/C=C(\C)C(O)C/C=C(\C)C(O)C/C=C(\C)CC[C@]1([H])C2(C)C |
| InChI | InChI=1S/C20H32O2/c1-13-6-9-16-17(20(16,4)5)12-15(3)19(22)11-8-14(2)18(21)10-7-13/h7-8,12,16-19,21-22H,6,9-11H2,1-5H3/b13-7+,14-8+,15-12+/t16-,17+,18?,19?/m0/s1 |
| InChIKey | GJAXTHSJTDLRTP-YTHUXUQLSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,8-dihydroxycasbene (CHEBI:157601) is a (−)-casbene (CHEBI:157595) |
| UniProt Name | Source |
|---|---|
| 4,8-dihydroxycasbene | UniProt |
| Citations |
|---|