EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | [H][C@@]12/C=C(\C)C(=O)C(O)/C=C(\C)C(O)C/C=C(\C)CC[C@]1([H])C2(C)C |
| InChI | InChI=1S/C20H30O3/c1-12-6-8-15-16(20(15,4)5)10-14(3)19(23)18(22)11-13(2)17(21)9-7-12/h7,10-11,15-18,21-22H,6,8-9H2,1-5H3/b12-7+,13-11+,14-10+/t15-,16+,17?,18?/m0/s1 |
| InChIKey | NGYQHXUVEHURAE-WCQVUEILSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,8-dihydroxy-4-oxocasbene (CHEBI:157604) is a (−)-casbene (CHEBI:157595) |
| Citations |
|---|