EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | C/C1=C\CC/C(C)=C/C2C(CC/C(C)=C/CC1)C2(C)C |
| InChI | InChI=1S/C20H32/c1-15-8-6-10-16(2)12-13-18-19(20(18,4)5)14-17(3)11-7-9-15/h9-10,14,18-19H,6-8,11-13H2,1-5H3/b15-9+,16-10+,17-14+ |
| InChIKey | ZJMVJDFTNPZVMB-QOCMWZQCSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| casbene (CHEBI:17695) has parent hydride casbane (CHEBI:36768) |
| casbene (CHEBI:17695) has role antifungal agent (CHEBI:35718) |
| casbene (CHEBI:17695) is a diterpene (CHEBI:35190) |
| Incoming Relation(s) |
| (−)-casbene (CHEBI:157595) is a casbene (CHEBI:17695) |
| IUPAC Name |
|---|
| (2E,6E,10E)-3,7,11,15,15-pentamethylbicyclo[12.1.0]pentadeca-2,6,10-triene |
| Synonym | Source |
|---|---|
| Casbene | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| casbene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01414 | KEGG COMPOUND |
| LMPR0104290001 | LIPID MAPS |
| C00000864 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5269179 | Reaxys |
| Citations |
|---|