EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O |
| Net Charge | 0 |
| Average Mass | 286.459 |
| Monoisotopic Mass | 286.22967 |
| SMILES | [H][C@@]12/C=C(\C)CC/C=C(\C)C(=O)C/C=C(\C)CC[C@]1([H])C2(C)C |
| InChI | InChI=1S/C20H30O/c1-14-9-11-17-18(20(17,4)5)13-15(2)7-6-8-16(3)19(21)12-10-14/h8,10,13,17-18H,6-7,9,11-12H2,1-5H3/b14-10+,15-13+,16-8+/t17-,18+/m0/s1 |
| InChIKey | OOHAYJPFBJKSFB-MFBRVKRESA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-oxocasbene (CHEBI:156572) is a (−)-casbene (CHEBI:157595) |
| Synonym | Source |
|---|---|
| 8-ketocasbene | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 8-oxocasbene | UniProt |
| Citations |
|---|