EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O |
| Net Charge | 0 |
| Average Mass | 288.475 |
| Monoisotopic Mass | 288.24532 |
| SMILES | [H][C@@]12/C=C(\C)C(O)C/C=C(\C)CC/C=C(\C)CC[C@]1([H])C2(C)C |
| InChI | InChI=1S/C20H32O/c1-14-7-6-8-15(2)10-12-19(21)16(3)13-18-17(11-9-14)20(18,4)5/h7,10,13,17-19,21H,6,8-9,11-12H2,1-5H3/b14-7+,15-10+,16-13+/t17-,18+,19?/m0/s1 |
| InChIKey | WMRXBBBPPAWODQ-YOIVSRADSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxycasbene (CHEBI:156578) is a (−)-casbene (CHEBI:157595) |
| UniProt Name | Source |
|---|---|
| 4-hydroxycasbene | UniProt |
| Citations |
|---|