InChI=1S/C30H40O5/c1- 17- 23- 18(14- 20(32) 24(17) 35- 7) 28(4) 11- 13- 30(6) 22- 16- 27(3,25(33) 34) 9- 8- 26(22,2) 10- 12- 29(30,5) 21(28) 15- 19(23) 31/h14- 15,22,32H,8- 13,16H2,1- 7H3,(H,33,34) /t22- ,26- ,27- ,28+,29- ,30+/m1/s1 |
KFGGKCFEQGLWFO-NLVUKCNFSA-N |
O=C1C=C2[C@@]3([C@]([C@]4([C@@](CC3)(CC[C@](C4)(C(=O)O)C)C)[H])(CC[C@]2(C=5C1=C(C(OC)=C(O)C5)C)C)C)C |
|
Tripterygium doianum
(NCBI:txid859951)
|
Found in
branch
(BTO:0000148).
See:
PubMed
|
Bronsted acid
A molecular entity capable of donating a hydron to an acceptor (Bronsted base).
(via oxoacid )
|
|
plant metabolite
Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms.
|
|
(2R,4aS,6aS,12bR,14aS,14bR)- 11- hydroxy- 10- methoxy- 2,4a,6a,9,12b,14a- hexamethyl- 8- oxo- 1,2,3,4,4a,5,6,6a,8,12b,13,14,14a,14b- tetradecahydropicene- 2- carboxylic acid
|