InChI=1S/C17H18O8/c1- 6- 3- 9(18) 12- 7(2) 16(22) 25- 14(12) 13- 8(4- 10(19) 11(6) 13) 5- 24- 17(23) 15(20) 21/h4,7,9,12- 14,18H,3,5H2,1- 2H3,(H,20,21) /t7?,9- ,12+,13- ,14- /m0/s1 |
ZIRFGNHEXDKBIN-WMNLTVTKSA-N |
O=C(O)C(=O)OCC1=CC(=O)C=2[C@]1([C@]3(OC(=O)C(C)[C@@]3([C@@H](O)CC2C)[H])[H])[H] |
|
Bronsted acid
A molecular entity capable of donating a hydron to an acceptor (Bronsted base).
(via oxoacid )
|
|
plant metabolite
Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms.
|
|
View more via ChEBI Ontology
{[(3S,3aR,4S,9aS,9bR)- 4- hydroxy- 3,6- dimethyl- 2,7- dioxo- 2,3,3a,4,5,7,9a,9b- octahydroazuleno[4,5- b]furan- 9- yl]methoxy}(oxo)acetic acid
|
11,13-dihydrolactucin 15-oxalate
|
ChEBI
|
15-oxalyl-11β,13-dihydrolactucin
|
ChEBI
|
|