InChI=1S/C29H38O5/c1- 16- 22- 17(13- 19(31) 23(16) 32) 27(4) 10- 12- 29(6) 21- 15- 26(3,24(33) 34) 8- 7- 25(21,2) 9- 11- 28(29,5) 20(27) 14- 18(22) 30/h13- 14,21,31- 32H,7- 12,15H2,1- 6H3,(H,33,34) /t21- ,25- ,26- ,27+,28- ,29+/m1/s1 |
MIQDJLKXHZPMHH-CPISFEQASA-N |
C12=CC(C3=C(C=C(C(=C3C)O)O)[C@@]1(CC[C@@]4([C@@]2(CC[C@@]5([C@]4(C[C@@](CC5)(C(O)=O)C)[H])C)C)C)C)=O |
|
Tripterygium regelii
(NCBI:txid123485)
|
Found in
stem
(BTO:0001300).
See:
PubMed
|
Bronsted acid
A molecular entity capable of donating a hydron to an acceptor (Bronsted base).
(via oxoacid )
|
|
plant metabolite
Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms.
|
|
(2R,4aS,6aS,12bR,14aS,14bR)- 10,11- dihydroxy- 2,4a,6a,9,12b,14a- hexamethyl- 8- oxo- 1,2,3,4,4a,5,6,6a,8,12b,13,14,14a,14b- tetradecahydropicene- 2- carboxylic acid
|