EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-17,19,21,23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17+,19+/m0/s1 |
| InChIKey | XEYBRNLFEZDVAW-ARSRFYASSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | |||
| - | MetaboLights (MTBLS143) | ||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. oxytocic A drug that stimulates contraction of the myometrium. Oxytocics are used to induce labour, obstetric at term, to prevent or control postpartum or postabortion haemorrhage, and to assess foetal status in high risk pregnancies. They may also be used alone or with other drugs to induce abortions (abortifacients). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin E2 (CHEBI:15551) has role analgesic (CHEBI:35480) |
| prostaglandin E2 (CHEBI:15551) has role antineoplastic agent (CHEBI:35610) |
| prostaglandin E2 (CHEBI:15551) has role human metabolite (CHEBI:77746) |
| prostaglandin E2 (CHEBI:15551) has role mouse metabolite (CHEBI:75771) |
| prostaglandin E2 (CHEBI:15551) has role oxytocic (CHEBI:36063) |
| prostaglandin E2 (CHEBI:15551) is a prostaglandins E (CHEBI:26338) |
| prostaglandin E2 (CHEBI:15551) is conjugate acid of prostaglandin E2(1−) (CHEBI:606564) |
| Incoming Relation(s) |
| 13,14-dihydro-15-oxo-prostaglandin E2 (CHEBI:15550) has functional parent prostaglandin E2 (CHEBI:15551) |
| 15-dehydro-prostaglandin E2 (CHEBI:15547) has functional parent prostaglandin E2 (CHEBI:15551) |
| 2-[(5Z,13E,15S)-11α,15-dihydroxy-9-oxoprosta-5,13-dien-1-oyl]-sn-glycero-3-phosphocholine (CHEBI:137585) has functional parent prostaglandin E2 (CHEBI:15551) |
| 2-[(5Z,13E,15S)-11α,15-dihydroxy-9-oxoprosta-5,13-dien-1-oyl]-sn-glycero-3-phosphoethanolamine (CHEBI:138361) has functional parent prostaglandin E2 (CHEBI:15551) |
| 20-hydroxyprostaglandin E2 (CHEBI:137370) has functional parent prostaglandin E2 (CHEBI:15551) |
| 8-epi-prostaglandin E2 (CHEBI:131888) has functional parent prostaglandin E2 (CHEBI:15551) |
| nitroproston (CHEBI:142127) has functional parent prostaglandin E2 (CHEBI:15551) |
| prostaglandin E2 1-glyceryl ester (CHEBI:90230) has functional parent prostaglandin E2 (CHEBI:15551) |
| prostaglandin E2 2-glyceryl ester (CHEBI:137172) has functional parent prostaglandin E2 (CHEBI:15551) |
| prostaglandin E2(1−) (CHEBI:606564) is conjugate base of prostaglandin E2 (CHEBI:15551) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-11α,15-dihydroxy-9-oxoprosta-5,13-dien-1-oic acid |
| INNs | Source |
|---|---|
| dinoprostona | WHO MedNet |
| dinoprostone | WHO MedNet |
| dinoprostone | WHO MedNet |
| dinoprostonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (15S)-prostaglandin E2 | ChemIDplus |
| (5Z,11α,13E,15S)-11,15-dihydroxy-9-oxoprosta-5,13-dien-1-oic acid | ChemIDplus |
| (5Z,13E)-(15S)-11alpha,15-Dihydroxy-9-oxoprost-13-enoate | KEGG COMPOUND |
| (5Z,13E)-(15S)-11alpha,15-Dihydroxy-9-oxoprosta-5,13-dienoate | KEGG COMPOUND |
| Dinoproston | ChemIDplus |
| dinoprostone | ChEMBL |
| Brand Names | Source |
|---|---|
| Cervidil | KEGG DRUG |
| Cerviprime | ChemIDplus |
| Cerviprost | ChemIDplus |
| Enzaprost E | ChemIDplus |
| Glandin-E2 | ChEBI |
| Minprositin E2 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 913 | DrugCentral |
| C00584 | KEGG COMPOUND |
| D00079 | KEGG DRUG |
| DB00917 | DrugBank |
| DE2011969 | Patent |
| FDB022498 | FooDB |
| GB851827 | Patent |
| HMDB0001220 | HMDB |
| LMFA03010003 | LIPID MAPS |
| LSM-42919 | LINCS |
| NL6505799 | Patent |
| P2E | PDBeChem |
| Prostaglandin_E2 | Wikipedia |
| US3598858 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2224724 | Reaxys |
| Beilstein:2224724 | Beilstein |
| CAS:363-24-6 | ChemIDplus |
| CAS:363-24-6 | KEGG COMPOUND |
| Citations |
|---|