EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | CCCCCC(=O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,16-17,19,23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t16-,17-,19-/m1/s1 |
| InChIKey | YRTJDWROBKPZNV-KMXMBPPJSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-dehydro-prostaglandin E2 (CHEBI:15547) has functional parent prostaglandin E2 (CHEBI:15551) |
| 15-dehydro-prostaglandin E2 (CHEBI:15547) is a prostaglandins E (CHEBI:26338) |
| 15-dehydro-prostaglandin E2 (CHEBI:15547) is conjugate acid of 15-dehydro-prostaglandin E2(1−) (CHEBI:57400) |
| Incoming Relation(s) |
| 15-dehydro-prostaglandin E2(1−) (CHEBI:57400) is conjugate base of 15-dehydro-prostaglandin E2 (CHEBI:15547) |
| IUPAC Name |
|---|
| (5Z,13E)-11α-hydroxy-9,15-dioxoprosta-5,13-dienoic acid |
| Synonyms | Source |
|---|---|
| 15-deoxy-15-oxo-prostaglandin E2 | ChEBI |
| 15-Keto-PGE2 | LIPID MAPS |
| 15-Keto-prostaglandin E2 | ChemIDplus |
| 15-Ketoprostaglandin E2 | ChemIDplus |
| 15-Oxo-PGE2 | ChemIDplus |
| (5Z,13E)-11alpha-Hydroxy-9,15-dioxoprost-13-enoate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04707 | KEGG COMPOUND |
| FDB023119 | FooDB |
| HMDB0003175 | HMDB |
| LMFA03010030 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:26441-05-4 | ChemIDplus |
| Citations |
|---|