EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O6 |
| Net Charge | 0 |
| Average Mass | 368.470 |
| Monoisotopic Mass | 368.21989 |
| SMILES | O=C(O)CCC/C=C\C[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)CCCCCO |
| InChI | InChI=1S/C20H32O6/c21-13-7-3-4-8-15(22)11-12-17-16(18(23)14-19(17)24)9-5-1-2-6-10-20(25)26/h1,5,11-12,15-17,19,21-22,24H,2-4,6-10,13-14H2,(H,25,26)/b5-1-,12-11+/t15-,16+,17+,19+/m0/s1 |
| InChIKey | AZIGEYVZEVXWAD-NZGURKHLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-hydroxyprostaglandin E2 (CHEBI:137370) has functional parent prostaglandin E2 (CHEBI:15551) |
| 20-hydroxyprostaglandin E2 (CHEBI:137370) is a primary alcohol (CHEBI:15734) |
| 20-hydroxyprostaglandin E2 (CHEBI:137370) is a prostaglandins E (CHEBI:26338) |
| 20-hydroxyprostaglandin E2 (CHEBI:137370) is a secondary allylic alcohol (CHEBI:134396) |
| 20-hydroxyprostaglandin E2 (CHEBI:137370) is a triol (CHEBI:27136) |
| 20-hydroxyprostaglandin E2 (CHEBI:137370) is conjugate acid of 20-hydroxyprostaglandin E2(1−) (CHEBI:136653) |
| Incoming Relation(s) |
| 20-hydroxyprostaglandin E2(1−) (CHEBI:136653) is conjugate base of 20-hydroxyprostaglandin E2 (CHEBI:137370) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-11α,15,20-trihydroxy-9-oxoprosta-5,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| 20-hydroxy prostaglandin E2 | ChEBI |
| 20-hydroxy-PGE2 | ChEBI |
| 20-hydroxy-prostaglandin E2 | ChEBI |
| 9-oxo-11R,15S,20-trihydroxy-5Z,13E-prostadienoic acid | LIPID MAPS |
| 20-OH-PGE2 | ChEBI |
| (5Z,11α,13E,15S)-11,15,20-trihydroxy-9-oxoprosta-5,13-dien-1-oic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| LMFA03010014 | LIPID MAPS |
| HMDB0003247 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2951905 | Reaxys |
| CAS:57930-95-7 | ChemIDplus |
| Citations |
|---|