EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-17,19,21,23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16-,17+,19+/m0/s1 |
| InChIKey | XEYBRNLFEZDVAW-CLQOMRTCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (12869634) | |
| Rattus norvegicus (ncbitaxon:10116) | |||
| - | PubMed (26654758) | ||
| - | MetaboLights (MTBLS278) |
| Roles Classification |
|---|
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | vasoconstrictor agent Drug used to cause constriction of the blood vessels. bronchoconstrictor agent A drug which causes a narrowing of the lumen of a bronchus or bronchiole. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-epi-prostaglandin E2 (CHEBI:131888) has functional parent prostaglandin E2 (CHEBI:15551) |
| 8-epi-prostaglandin E2 (CHEBI:131888) has role bronchoconstrictor agent (CHEBI:50141) |
| 8-epi-prostaglandin E2 (CHEBI:131888) has role human metabolite (CHEBI:77746) |
| 8-epi-prostaglandin E2 (CHEBI:131888) has role rat metabolite (CHEBI:86264) |
| 8-epi-prostaglandin E2 (CHEBI:131888) has role vasoconstrictor agent (CHEBI:50514) |
| 8-epi-prostaglandin E2 (CHEBI:131888) is a cyclic ketone (CHEBI:3992) |
| 8-epi-prostaglandin E2 (CHEBI:131888) is a diol (CHEBI:23824) |
| 8-epi-prostaglandin E2 (CHEBI:131888) is a prostanoid (CHEBI:26347) |
| 8-epi-prostaglandin E2 (CHEBI:131888) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| 8-epi-prostaglandin E2 anion (CHEBI:747137) is conjugate base of 8-epi-prostaglandin E2 (CHEBI:131888) |
| IUPAC Name |
|---|
| (5Z,8β,11α,13E,15S)-11,15-dihydroxy-9-oxoprosta-5,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| 7-[3-Hydroxy-2-(3-hydroxy-1-octenyl)-5-oxocyclopentyl]-5-heptenoic acid | HMDB |
| 8-epi-PGE2 | ChEBI |
| 8-iso-PGE2 | ChEBI |
| 8-isoprostaglandin E2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4446334 | ChemSpider |
| HMDB0005844 | HMDB |
| LMFA03110003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4709355 | Reaxys |
| CAS:27415-25-4 | ChemIDplus |
| Citations |
|---|