EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H36N2O11 |
| Net Charge | 0 |
| Average Mass | 516.544 |
| Monoisotopic Mass | 516.23191 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)OC(CO[N+](=O)[O-])CO[N+](=O)[O-] |
| InChI | InChI=1S/C23H36N2O11/c1-2-3-6-9-17(26)12-13-20-19(21(27)14-22(20)28)10-7-4-5-8-11-23(29)36-18(15-34-24(30)31)16-35-25(32)33/h4,7,12-13,17-20,22,26,28H,2-3,5-6,8-11,14-16H2,1H3/b7-4-,13-12+/t17-,19+,20+,22+/m0/s1 |
| InChIKey | SGMBTYBNUOWYOV-CXZSOYKBSA-N |
| Roles Classification |
|---|
| Applications: | anti-asthmatic drug A drug used to treat asthma. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitroproston (CHEBI:142127) has functional parent 1,3-dinitroglycerol (CHEBI:18921) |
| nitroproston (CHEBI:142127) has functional parent prostaglandin E2 (CHEBI:15551) |
| nitroproston (CHEBI:142127) has role anti-asthmatic drug (CHEBI:49167) |
| nitroproston (CHEBI:142127) has role bronchodilator agent (CHEBI:35523) |
| nitroproston (CHEBI:142127) is a carboxylic ester (CHEBI:33308) |
| nitroproston (CHEBI:142127) is a nitro compound (CHEBI:35715) |
| nitroproston (CHEBI:142127) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 1,3-bis(nitrooxy)propan-2-yl (5Z,11α,13E,15S)-11,15-dihydroxy-9-oxoprosta-5,13-dien-1-oate |
| Synonyms | Source |
|---|---|
| prostaglandin E2 1,3-bis(nitrooxy)prop-2-yl ester | ChEBI |
| nitroproston | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US2015141505 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19341527 | Reaxys |
| Citations |
|---|