EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O5 |
| Net Charge | -1 |
| Average Mass | 351.463 |
| Monoisotopic Mass | 351.21770 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-17,19,21,23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/p-1/b7-4-,13-12+/t15-,16+,17+,19+/m0/s1 |
| InChIKey | XEYBRNLFEZDVAW-ARSRFYASSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | oxytocic A drug that stimulates contraction of the myometrium. Oxytocics are used to induce labour, obstetric at term, to prevent or control postpartum or postabortion haemorrhage, and to assess foetal status in high risk pregnancies. They may also be used alone or with other drugs to induce abortions (abortifacients). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin E2(1−) (CHEBI:606564) has role human metabolite (CHEBI:77746) |
| prostaglandin E2(1−) (CHEBI:606564) has role oxytocic (CHEBI:36063) |
| prostaglandin E2(1−) (CHEBI:606564) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| prostaglandin E2(1−) (CHEBI:606564) is conjugate base of prostaglandin E2 (CHEBI:15551) |
| Incoming Relation(s) |
| 20-hydroxyprostaglandin E2(1−) (CHEBI:136653) has functional parent prostaglandin E2(1−) (CHEBI:606564) |
| 8-epi-prostaglandin E2 anion (CHEBI:747137) has functional parent prostaglandin E2(1−) (CHEBI:606564) |
| bicyclo-PGE2(1-) (CHEBI:747157) has functional parent prostaglandin E2(1−) (CHEBI:606564) |
| prostaglandin E2 (CHEBI:15551) is conjugate acid of prostaglandin E2(1−) (CHEBI:606564) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-11α,15-dihydroxy-9-oxoprosta-5,13-dien-1-oate |
| Synonym | Source |
|---|---|
| prostaglandin E2 anion | ChEBI |
| UniProt Name | Source |
|---|---|
| prostaglandin E2 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8364130 | Beilstein |