EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H45N5O14 |
| Net Charge | 0 |
| Average Mass | 615.634 |
| Monoisotopic Mass | 615.29630 |
| SMILES | NC[C@@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)O[C@@H]2CO)[C@H](N)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H45N5O14/c24-2-7-13(32)15(34)10(27)21(37-7)41-19-9(4-30)39-23(17(19)36)42-20-12(31)5(25)1-6(26)18(20)40-22-11(28)16(35)14(33)8(3-29)38-22/h5-23,29-36H,1-4,24-28H2/t5-,6+,7+,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | UOZODPSAJZTQNH-LSWIJEOBSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiparasitic agent A substance used to treat or prevent parasitic infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. anthelminthic drug Substance intended to kill parasitic worms (helminths). antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paromomycin (CHEBI:7934) has functional parent streptamine (CHEBI:27955) |
| paromomycin (CHEBI:7934) has role anthelminthic drug (CHEBI:35443) |
| paromomycin (CHEBI:7934) has role antibacterial drug (CHEBI:36047) |
| paromomycin (CHEBI:7934) has role antiparasitic agent (CHEBI:35442) |
| paromomycin (CHEBI:7934) has role antiprotozoal drug (CHEBI:35820) |
| paromomycin (CHEBI:7934) is a amino cyclitol glycoside (CHEBI:22479) |
| paromomycin (CHEBI:7934) is a aminoglycoside antibiotic (CHEBI:22507) |
| paromomycin (CHEBI:7934) is conjugate base of paromomycin(5+) (CHEBI:233202) |
| Incoming Relation(s) |
| lividomycin A (CHEBI:71961) has functional parent paromomycin (CHEBI:7934) |
| lividomycin B (CHEBI:71962) has functional parent paromomycin (CHEBI:7934) |
| paromomycin sulfate (CHEBI:7935) has functional parent paromomycin (CHEBI:7934) |
| paromomycin(5+) (CHEBI:233202) is conjugate acid of paromomycin (CHEBI:7934) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2-{[3-O-(2,6-diamino-2,6-dideoxy-β-L-idopyranosyl)-β-D-ribofuranosyl]oxy}-3-hydroxycyclohexyl 2-amino-2-deoxy-α-D-glucopyranoside |
| INNs | Source |
|---|---|
| paromomicina | ChemIDplus |
| paromomycin | WHO MedNet |
| paromomycine | ChemIDplus |
| paromomycinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2-{[3-O-(2,6-diamino-2,6-dideoxy-beta-L-idopyranosyl)-beta-D-ribofuranosyl]oxy}-3-hydroxycyclohexyl 2-amino-2-deoxy-alpha-D-glucopyranoside | PDBeChem |
| Aminosidin | KEGG COMPOUND |
| aminosidine | ChemIDplus |
| Catenulin | KEGG COMPOUND |
| crestomycin | ChemIDplus |
| estomycin | ChemIDplus |
| Citations |
|---|