EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H45N5O14 |
| Net Charge | 0 |
| Average Mass | 615.634 |
| Monoisotopic Mass | 615.29630 |
| SMILES | NC[C@@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)O[C@@H]2CO)[C@H](N)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H45N5O14/c24-2-7-13(32)15(34)10(27)21(37-7)41-19-9(4-30)39-23(17(19)36)42-20-12(31)5(25)1-6(26)18(20)40-22-11(28)16(35)14(33)8(3-29)38-22/h5-23,29-36H,1-4,24-28H2/t5-,6+,7+,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | UOZODPSAJZTQNH-LSWIJEOBSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | anthelminthic drug Substance intended to kill parasitic worms (helminths). antibacterial drug A drug used to treat or prevent bacterial infections. antiparasitic agent A substance used to treat or prevent parasitic infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paromomycin (CHEBI:7934) has functional parent streptamine (CHEBI:27955) |
| paromomycin (CHEBI:7934) has role anthelminthic drug (CHEBI:35443) |
| paromomycin (CHEBI:7934) has role antibacterial drug (CHEBI:36047) |
| paromomycin (CHEBI:7934) has role antiparasitic agent (CHEBI:35442) |
| paromomycin (CHEBI:7934) has role antiprotozoal drug (CHEBI:35820) |
| paromomycin (CHEBI:7934) is a amino cyclitol glycoside (CHEBI:22479) |
| paromomycin (CHEBI:7934) is a aminoglycoside antibiotic (CHEBI:22507) |
| paromomycin (CHEBI:7934) is conjugate base of paromomycin(5+) (CHEBI:233202) |
| Incoming Relation(s) |
| lividomycin A (CHEBI:71961) has functional parent paromomycin (CHEBI:7934) |
| lividomycin B (CHEBI:71962) has functional parent paromomycin (CHEBI:7934) |
| paromomycin sulfate (CHEBI:7935) has functional parent paromomycin (CHEBI:7934) |
| paromomycin(5+) (CHEBI:233202) is conjugate acid of paromomycin (CHEBI:7934) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2-{[3-O-(2,6-diamino-2,6-dideoxy-β-L-idopyranosyl)-β-D-ribofuranosyl]oxy}-3-hydroxycyclohexyl 2-amino-2-deoxy-α-D-glucopyranoside |
| INNs | Source |
|---|---|
| paromomicina | ChemIDplus |
| paromomycin | WHO MedNet |
| paromomycine | ChemIDplus |
| paromomycinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2-{[3-O-(2,6-diamino-2,6-dideoxy-beta-L-idopyranosyl)-beta-D-ribofuranosyl]oxy}-3-hydroxycyclohexyl 2-amino-2-deoxy-alpha-D-glucopyranoside | PDBeChem |
| Aminosidin | KEGG COMPOUND |
| aminosidine | ChemIDplus |
| Catenulin | KEGG COMPOUND |
| crestomycin | ChemIDplus |
| estomycin | ChemIDplus |
| Citations |
|---|