EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H45N5O13 |
| Net Charge | 0 |
| Average Mass | 599.635 |
| Monoisotopic Mass | 599.30139 |
| SMILES | NC[C@@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)C[C@H]3N)O[C@@H]2CO)[C@H](N)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H45N5O13/c24-3-10-15(33)16(34)13(28)22(36-10)40-19-12(5-30)38-23(17(19)35)41-20-14(32)6(25)1-7(26)18(20)39-21-8(27)2-9(31)11(4-29)37-21/h6-23,29-35H,1-5,24-28H2/t6-,7+,8-,9+,10+,11-,12-,13-,14+,15-,16-,17-,18-,19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | BRSBFYLXCMGALM-CDEWKRIDSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lividomycin B (CHEBI:71962) has functional parent paromomycin (CHEBI:7934) |
| lividomycin B (CHEBI:71962) has role metabolite (CHEBI:25212) |
| lividomycin B (CHEBI:71962) is a lividomycins (CHEBI:71960) |
| Incoming Relation(s) |
| lividomycin A (CHEBI:71961) has functional parent lividomycin B (CHEBI:71962) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2-{[3-O-(2,6-diamino-2,6-dideoxy-β-L-idopyranosyl)-β-D-ribofuranosyl]oxy}-3-hydroxycyclohexyl 2-amino-2,3-dideoxy-α-D-ribo-hexopyranoside |
| Synonyms | Source |
|---|---|
| 3'-deoxyparomomycin I | ChemIDplus |
| quintomycin D | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6494789 | Reaxys |
| CAS:37636-51-4 | ChemIDplus |
| CAS:37636-51-4 | KEGG COMPOUND |
| Citations |
|---|