EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (H2O4S)n.C23H45N5O14 |
| Net Charge | 0 |
| Average Mass | 713.713 |
| Monoisotopic Mass | 713.26368 |
| SMILES | NC[C@@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)O[C@@H]2CO)[C@H](N)[C@@H](O)[C@@H]1O.O=S(=O)(O)O |
| InChI | InChI=1S/C23H45N5O14.H2O4S/c24-2-7-13(32)15(34)10(27)21(37-7)41-19-9(4-30)39-23(17(19)36)42-20-12(31)5(25)1-6(26)18(20)40-22-11(28)16(35)14(33)8(3-29)38-22;1-5(2,3)4/h5-23,29-36H,1-4,24-28H2;(H2,1,2,3,4)/t5-,6+,7+,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+;/m1./s1 |
| InChIKey | LJRDOKAZOAKLDU-UDXJMMFXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Applications: | anthelminthic drug Substance intended to kill parasitic worms (helminths). antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paromomycin sulfate (CHEBI:7935) has functional parent paromomycin (CHEBI:7934) |
| paromomycin sulfate (CHEBI:7935) has role anthelminthic drug (CHEBI:35443) |
| paromomycin sulfate (CHEBI:7935) has role antibacterial drug (CHEBI:36047) |
| paromomycin sulfate (CHEBI:7935) has role antiparasitic agent (CHEBI:35442) |
| paromomycin sulfate (CHEBI:7935) has role antiprotozoal drug (CHEBI:35820) |
| paromomycin sulfate (CHEBI:7935) is a aminoglycoside sulfate salt (CHEBI:38012) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2-{[3-O-(2,6-diamino-2,6-dideoxy-β-L-idopyranosyl)-β-D-ribofuranosyl]oxy}-3-hydroxycyclohexyl 2-amino-2-deoxy-α-D-glucopyranoside sulfate |
| Synonyms | Source |
|---|---|
| aminosidine sulfate | ChemIDplus |
| aminosidine sulphate | ChemIDplus |
| aminosidin sulfate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Humatin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D00868 | KEGG DRUG |
| DB01421 | DrugBank |
| Paromomycin_sulfate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21343285 | Reaxys |
| CAS:1263-89-4 | ChemIDplus |
| CAS:1263-89-4 | KEGG DRUG |
| Citations |
|---|