EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (H2O4S)n.C23H45N5O14 |
| Net Charge | 0 |
| Average Mass | 713.713 |
| Monoisotopic Mass | 713.26368 |
| SMILES | NC[C@@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)O[C@@H]2CO)[C@H](N)[C@@H](O)[C@@H]1O.O=S(=O)(O)O |
| InChI | InChI=1S/C23H45N5O14.H2O4S/c24-2-7-13(32)15(34)10(27)21(37-7)41-19-9(4-30)39-23(17(19)36)42-20-12(31)5(25)1-6(26)18(20)40-22-11(28)16(35)14(33)8(3-29)38-22;1-5(2,3)4/h5-23,29-36H,1-4,24-28H2;(H2,1,2,3,4)/t5-,6+,7+,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+;/m1./s1 |
| InChIKey | LJRDOKAZOAKLDU-UDXJMMFXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | antiparasitic agent A substance used to treat or prevent parasitic infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. anthelminthic drug Substance intended to kill parasitic worms (helminths). antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paromomycin sulfate (CHEBI:7935) has functional parent paromomycin (CHEBI:7934) |
| paromomycin sulfate (CHEBI:7935) has role anthelminthic drug (CHEBI:35443) |
| paromomycin sulfate (CHEBI:7935) has role antibacterial drug (CHEBI:36047) |
| paromomycin sulfate (CHEBI:7935) has role antiparasitic agent (CHEBI:35442) |
| paromomycin sulfate (CHEBI:7935) has role antiprotozoal drug (CHEBI:35820) |
| paromomycin sulfate (CHEBI:7935) is a aminoglycoside sulfate salt (CHEBI:38012) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2-{[3-O-(2,6-diamino-2,6-dideoxy-β-L-idopyranosyl)-β-D-ribofuranosyl]oxy}-3-hydroxycyclohexyl 2-amino-2-deoxy-α-D-glucopyranoside sulfate |
| Synonyms | Source |
|---|---|
| aminosidine sulfate | ChemIDplus |
| aminosidine sulphate | ChemIDplus |
| aminosidin sulfate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Humatin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D00868 | KEGG DRUG |
| DB01421 | DrugBank |
| Paromomycin_sulfate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21343285 | Reaxys |
| CAS:1263-89-4 | ChemIDplus |
| CAS:1263-89-4 | KEGG DRUG |
| Citations |
|---|