EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H50N5O14 |
| Net Charge | +5 |
| Average Mass | 620.674 |
| Monoisotopic Mass | 620.33268 |
| SMILES | [NH3+]C[C@@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O[C@@H]3[C@@H](O)[C@H]([NH3+])C[C@H]([NH3+])[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3[NH3+])O[C@@H]2CO)[C@H]([NH3+])[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H45N5O14/c24-2-7-13(32)15(34)10(27)21(37-7)41-19-9(4-30)39-23(17(19)36)42-20-12(31)5(25)1-6(26)18(20)40-22-11(28)16(35)14(33)8(3-29)38-22/h5-23,29-36H,1-4,24-28H2/p+5/t5-,6+,7+,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | UOZODPSAJZTQNH-LSWIJEOBSA-S |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paromomycin(5+) (CHEBI:233202) is a ammonium ion derivative (CHEBI:35274) |
| paromomycin(5+) (CHEBI:233202) is conjugate acid of paromomycin (CHEBI:7934) |
| Incoming Relation(s) |
| 4'-adenylylparomomycin(4+) (CHEBI:233203) has functional parent paromomycin(5+) (CHEBI:233202) |
| paromomycin (CHEBI:7934) is conjugate base of paromomycin(5+) (CHEBI:233202) |
| UniProt Name | Source |
|---|---|
| paromomycin | UniProt |
| Citations |
|---|