EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H55N5O18 |
| Net Charge | 0 |
| Average Mass | 761.776 |
| Monoisotopic Mass | 761.35421 |
| SMILES | NC[C@@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)C[C@H]3N)O[C@@H]2CO)[C@H](N)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H55N5O18/c30-3-11-23(51-28-20(43)19(42)17(40)13(5-36)47-28)18(41)15(34)27(45-11)50-24-14(6-37)48-29(21(24)44)52-25-16(39)7(31)1-8(32)22(25)49-26-9(33)2-10(38)12(4-35)46-26/h7-29,35-44H,1-6,30-34H2/t7-,8+,9-,10+,11+,12-,13-,14-,15-,16+,17-,18-,19+,20+,21-,22-,23-,24-,25-,26-,27-,28-,29+/m1/s1 |
| InChIKey | DBLVDAUGBTYDFR-SWMBIRFSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lividomycin A (CHEBI:71961) has functional parent lividomycin B (CHEBI:71962) |
| lividomycin A (CHEBI:71961) has functional parent paromomycin (CHEBI:7934) |
| lividomycin A (CHEBI:71961) has role metabolite (CHEBI:25212) |
| lividomycin A (CHEBI:71961) is a lividomycins (CHEBI:71960) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-3-hydroxy-2-{[α-D-mannopyranosyl-(1→4)-2,6-diamino-2,6-dideoxy-β-L-idopyranosyl-(1→3)-β-D-ribofuranosyl]oxy}cyclohexyl 2-amino-2,3-dideoxy-α-D-ribo-hexopyranoside |
| INNs | Source |
|---|---|
| lividomicina | ChemIDplus |
| lividomycin | ChemIDplus |
| lividomycine | ChemIDplus |
| lividomycinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| antibiotic 503-2 | ChemIDplus |
| antibiotic SF 767 A | ChemIDplus |
| O-2-amino-2,3-dideoxy-α-D-ribo-hexopyranosyl-(1-4)-O-(O-α-D-mannopyranosyl-(1-4)-O-2,6-diamino-2,6-dideoxy-β-L-idopyranosyl-(1-3)-β-D-ribofuranosyl-(1-5))-2-deoxy-D-streptamine | ChemIDplus |
| mannosyldeoxyparomomycin | ChemIDplus |
| quintomycin B | ChemIDplus |
| SF 767 A | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C17707 | KEGG COMPOUND |
| CPD-14175 | MetaCyc |
| DB04728 | DrugBank |
| LIV | PDBeChem |
| Lividomycin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6763509 | Reaxys |
| CAS:36441-41-5 | ChemIDplus |
| CAS:36441-41-5 | KEGG COMPOUND |
| Citations |
|---|