EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6O3 |
| Net Charge | 0 |
| Average Mass | 90.078 |
| Monoisotopic Mass | 90.03169 |
| SMILES | CC(O)C(=O)O |
| InChI | InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6) |
| InChIKey | JVTAAEKCZFNVCJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) | |
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| IUPAC Name |
|---|
| 2-hydroxypropanoic acid |
| Synonyms | Source |
|---|---|
| 2-Hydroxypropionic acid | KEGG COMPOUND |
| 2-Hydroxypropanoic acid | KEGG COMPOUND |
| Lactic acid | KEGG COMPOUND |