EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:78320 - 2-hydroxypropanoic acid
| Formula | C3H6O3 |
| Net Charge | 0 |
| Average Mass | 90.078 |
| Monoisotopic Mass | 90.03169 |
| SMILES | CC(O)C(=O)O |
| InChI | InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6) |
| InChIKey | JVTAAEKCZFNVCJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) | |
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxypropanoic acid (CHEBI:78320) has functional parent propionic acid (CHEBI:30768) |
| 2-hydroxypropanoic acid (CHEBI:78320) has role Daphnia magna metabolite (CHEBI:83056) |
| 2-hydroxypropanoic acid (CHEBI:78320) has role algal metabolite (CHEBI:84735) |
| 2-hydroxypropanoic acid (CHEBI:78320) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| 2-hydroxypropanoic acid (CHEBI:78320) is conjugate acid of lactate (CHEBI:24996) |
| Incoming Relation(s) |
| 3-(4-hydroxy-3,5-diiodophenyl)lactic acid (CHEBI:16122) has functional parent 2-hydroxypropanoic acid (CHEBI:78320) |
| 3-(imidazol-5-yl)lactic acid (CHEBI:27487) has functional parent 2-hydroxypropanoic acid (CHEBI:78320) |
| 3-methylbutyl 2-hydroxypropanoate (CHEBI:87534) has functional parent 2-hydroxypropanoic acid (CHEBI:78320) |
| butyl butyryllactate (CHEBI:168668) has functional parent 2-hydroxypropanoic acid (CHEBI:78320) |
| ethyl 2-hydroxypropanoate (CHEBI:78321) has functional parent 2-hydroxypropanoic acid (CHEBI:78320) |
| lactate ester (CHEBI:83219) has functional parent 2-hydroxypropanoic acid (CHEBI:78320) |
| (R)-lactic acid (CHEBI:42111) is a 2-hydroxypropanoic acid (CHEBI:78320) |
| (S)-lactic acid (CHEBI:422) is a 2-hydroxypropanoic acid (CHEBI:78320) |
| lactate (CHEBI:24996) is conjugate base of 2-hydroxypropanoic acid (CHEBI:78320) |
| IUPAC Name |
|---|
| 2-hydroxypropanoic acid |
| Synonyms | Source |
|---|---|
| 2-Hydroxypropionic acid | KEGG COMPOUND |
| 2-Hydroxypropanoic acid | KEGG COMPOUND |
| Lactic acid | KEGG COMPOUND |