EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O3 |
| Net Charge | 0 |
| Average Mass | 118.132 |
| Monoisotopic Mass | 118.06299 |
| SMILES | CCOC(=O)C(C)O |
| InChI | InChI=1S/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3 |
| InChIKey | LZCLXQDLBQLTDK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 2-hydroxypropanoate (CHEBI:78321) has functional parent 2-hydroxypropanoic acid (CHEBI:78320) |
| ethyl 2-hydroxypropanoate (CHEBI:78321) has role metabolite (CHEBI:25212) |
| ethyl 2-hydroxypropanoate (CHEBI:78321) is a ethyl ester (CHEBI:23990) |
| ethyl 2-hydroxypropanoate (CHEBI:78321) is a lactate ester (CHEBI:83219) |
| ethyl 2-hydroxypropanoate (CHEBI:78321) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| ethyl (2R)-lactate (CHEBI:78323) is a ethyl 2-hydroxypropanoate (CHEBI:78321) |
| ethyl (2S)-lactate (CHEBI:78322) is a ethyl 2-hydroxypropanoate (CHEBI:78321) |
| IUPAC Name |
|---|
| ethyl 2-hydroxypropanoate |
| Synonym | Source |
|---|---|
| ethyl lactate | ChEBI |