EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:422 - (S)-lactic acid
| Formula | C3H6O3 |
| Net Charge | 0 |
| Average Mass | 90.078 |
| Monoisotopic Mass | 90.03169 |
| SMILES | C[C@H](O)C(=O)O |
| InChI | InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m0/s1 |
| InChIKey | JVTAAEKCZFNVCJ-REOHCLBHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-lactic acid (CHEBI:422) has role Escherichia coli metabolite (CHEBI:76971) |
| (S)-lactic acid (CHEBI:422) has role human metabolite (CHEBI:77746) |
| (S)-lactic acid (CHEBI:422) is a (2S)-2-hydroxy monocarboxylic acid (CHEBI:17375) |
| (S)-lactic acid (CHEBI:422) is a 2-hydroxypropanoic acid (CHEBI:78320) |
| (S)-lactic acid (CHEBI:422) is conjugate acid of (S)-lactate (CHEBI:16651) |
| (S)-lactic acid (CHEBI:422) is enantiomer of (R)-lactic acid (CHEBI:42111) |
| Incoming Relation(s) |
| rac-lactic acid (CHEBI:28358) has part (S)-lactic acid (CHEBI:422) |
| (S)-lactate (CHEBI:16651) is conjugate base of (S)-lactic acid (CHEBI:422) |
| (R)-lactic acid (CHEBI:42111) is enantiomer of (S)-lactic acid (CHEBI:422) |
| IUPAC Name |
|---|
| (2S)-2-hydroxypropanoic acid |
| Synonyms | Source |
|---|---|
| L-Lactic acid | KEGG COMPOUND |
| L-(+)-lactic acid | NIST Chemistry WebBook |
| (S)-(+)-lactic acid | NIST Chemistry WebBook |
| (+)-lactic acid | NIST Chemistry WebBook |
| (S)-2-hydroxypropionic acid | NIST Chemistry WebBook |
| (S)-2-hydroxypropanoic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C00186 | KEGG COMPOUND |
| Lactic_Acid | Wikipedia |
| HMDB0000190 | HMDB |
| C00001191 | KNApSAcK |
| Citations |
|---|