EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O3 |
| Net Charge | 0 |
| Average Mass | 160.213 |
| Monoisotopic Mass | 160.10994 |
| SMILES | CC(C)CCOC(=O)C(C)O |
| InChI | InChI=1S/C8H16O3/c1-6(2)4-5-11-8(10)7(3)9/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | CRORGGSWAKIXSA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylbutyl 2-hydroxypropanoate (CHEBI:87534) has functional parent 2-hydroxypropanoic acid (CHEBI:78320) |
| 3-methylbutyl 2-hydroxypropanoate (CHEBI:87534) has functional parent isoamylol (CHEBI:15837) |
| 3-methylbutyl 2-hydroxypropanoate (CHEBI:87534) has role metabolite (CHEBI:25212) |
| 3-methylbutyl 2-hydroxypropanoate (CHEBI:87534) is a carboxylic ester (CHEBI:33308) |
| IUPAC Name |
|---|
| 3-methylbutyl 2-hydroxypropanoate |
| Synonyms | Source |
|---|---|
| Isoamyl lactate | ChemIDplus |
| Isopentyl lactate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059825 | HMDB |
| WO2011144273 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1703537 | Reaxys |
| CAS:19329-89-6 | ChemIDplus |
| Citations |
|---|