EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O |
| Net Charge | 0 |
| Average Mass | 286.459 |
| Monoisotopic Mass | 286.22967 |
| SMILES | [H][C@@]12CCc3cc(C(C)C)c(O)cc3[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H30O/c1-13(2)15-11-14-7-8-18-19(3,4)9-6-10-20(18,5)16(14)12-17(15)21/h11-13,18,21H,6-10H2,1-5H3/t18-,20+/m0/s1 |
| InChIKey | QXNWVJOHUAQHLM-AZUAARDMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferruginol (CHEBI:78274) has role antibacterial agent (CHEBI:33282) |
| ferruginol (CHEBI:78274) has role antineoplastic agent (CHEBI:35610) |
| ferruginol (CHEBI:78274) has role plant metabolite (CHEBI:76924) |
| ferruginol (CHEBI:78274) has role protective agent (CHEBI:50267) |
| ferruginol (CHEBI:78274) is a abietane diterpenoid (CHEBI:36762) |
| ferruginol (CHEBI:78274) is a carbotricyclic compound (CHEBI:38032) |
| ferruginol (CHEBI:78274) is a meroterpenoid (CHEBI:64419) |
| ferruginol (CHEBI:78274) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| 11-hydroxyferruginol (CHEBI:138942) has functional parent ferruginol (CHEBI:78274) |
| 11-hydroxysugiol (CHEBI:138962) has functional parent ferruginol (CHEBI:78274) |
| 11,20-dihydroxyferruginol (CHEBI:138965) has functional parent ferruginol (CHEBI:78274) |
| 11,20-dihydroxysugiol (CHEBI:138963) has functional parent ferruginol (CHEBI:78274) |
| 6β-hydroxyferruginol (CHEBI:70577) has functional parent ferruginol (CHEBI:78274) |
| salviol (CHEBI:138944) has functional parent ferruginol (CHEBI:78274) |
| sugiol (CHEBI:138961) has functional parent ferruginol (CHEBI:78274) |
| IUPAC Name |
|---|
| abieta-8,11,13-trien-12-ol |
| Synonyms | Source |
|---|---|
| 12-hydroxyabieta-8,11,13-triene | ChEBI |
| 8,11,13-abietatrien-12-ol | ChEBI |
| UniProt Name | Source |
|---|---|
| ferruginol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003426 | KNApSAcK |
| C09092 | KEGG COMPOUND |
| CPD-16534 | MetaCyc |
| Ferruginol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5275000 | Reaxys |
| CAS:514-62-5 | KEGG COMPOUND |
| Citations |
|---|