EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | [H][C@@]12CC(=O)c3cc(C(C)C)c(O)c(O)c3[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H28O3/c1-11(2)12-9-13-14(21)10-15-19(3,4)7-6-8-20(15,5)16(13)18(23)17(12)22/h9,11,15,22-23H,6-8,10H2,1-5H3/t15-,20-/m0/s1 |
| InChIKey | GDLRDIDXYBIPFY-YWZLYKJASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caryopteris glutinosa (IPNI:861589-1) | whole plant (BTO:0001461) | PubMed (26900877) | 95% EtOH extract |
| Caryopteris incana (ncbitaxon:41386) | whole plant (BTO:0001461) | DOI (10.1039/C6OB00139D) | |
| Caryopteris mongholica (ncbitaxon:201515) | aerial part (BTO:0001658) | PubMed (25900047) | |
| Plectranthus cyaneus (IPNI:454339-1) | leaf (BTO:0000713) | DOI (10.1002/hlca.200490210) | |
| Salvia phlomoides (ncbitaxon:1520037) | root (BTO:0001188) | Article (Phytochemistry, 1983, 22(9), 2005-2009 1983) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-hydroxysugiol (CHEBI:138962) has functional parent ferruginol (CHEBI:78274) |
| 11-hydroxysugiol (CHEBI:138962) has functional parent sugiol (CHEBI:138961) |
| 11-hydroxysugiol (CHEBI:138962) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| 11-hydroxysugiol (CHEBI:138962) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| 11-hydroxysugiol (CHEBI:138962) has role plant metabolite (CHEBI:76924) |
| 11-hydroxysugiol (CHEBI:138962) is a abietane diterpenoid (CHEBI:36762) |
| 11-hydroxysugiol (CHEBI:138962) is a carbotricyclic compound (CHEBI:38032) |
| 11-hydroxysugiol (CHEBI:138962) is a catechols (CHEBI:33566) |
| 11-hydroxysugiol (CHEBI:138962) is a cyclic terpene ketone (CHEBI:36130) |
| 11-hydroxysugiol (CHEBI:138962) is a meroterpenoid (CHEBI:64419) |
| Incoming Relation(s) |
| 11,20-dihydroxysugiol (CHEBI:138963) has functional parent 11-hydroxysugiol (CHEBI:138962) |
| IUPAC Name |
|---|
| 11,12-dihydroxyabieta-8,11,13-trien-7-one |
| Synonyms | Source |
|---|---|
| 12-O-demethylcryptojapanol | ChEBI |
| 12-O-demethylcryptojaponol | ChEBI |
| (4aS,10aS)-2,3,4,4a,10,10a-hexahydro-5,6-dihydroxy-1,1,4a-trimethyl-7-(1-methylethyl)phenanthren-9(1H)-one | ChEBI |
| UniProt Name | Source |
|---|---|
| 11-hydroxysugiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20269 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2060230 | Reaxys |
| Citations |
|---|