EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O2 |
| Net Charge | 0 |
| Average Mass | 300.442 |
| Monoisotopic Mass | 300.20893 |
| SMILES | [H][C@@]12CC(=O)c3cc(C(C)C)c(O)cc3[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H28O2/c1-12(2)13-9-14-15(10-16(13)21)20(5)8-6-7-19(3,4)18(20)11-17(14)22/h9-10,12,18,21H,6-8,11H2,1-5H3/t18-,20+/m0/s1 |
| InChIKey | IPEHJNRNYPOFII-AZUAARDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calocedrus formosana (ncbitaxon:54798) | bark (BTO:0001301) | PubMed (15856404) | |
| Celastrus orbiculatus (ncbitaxon:85181) | root (BTO:0001188) | PubMed (24134003) | |
| Cephalotaxus lanceolata (ncbitaxon:450881) | |||
| twig (BTO:0000713) | PubMed (28399666) | ||
| leaf (BTO:0000713) | PubMed (28399666) | ||
| Cryptomeria japonica (ncbitaxon:3369) | bark (BTO:0001301) | PubMed (IND500669066) | |
| Isodon rugosus (ncbitaxon:204135) | - | PubMed (27458379) | |
| Juniperus procera (ncbitaxon:62753) | - | PubMed (22459455) | petroleum ether fraction |
| Metasequoia glyptostroboides (ncbitaxon:3371) | - | PubMed (27383486) | |
| Salvia castanea (ncbitaxon:476450) | - | PubMed (23019884) | |
| Salvia leriifolia (ncbitaxon:1933732) | - | PubMed (22174076) |
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sugiol (CHEBI:138961) has functional parent ferruginol (CHEBI:78274) |
| sugiol (CHEBI:138961) has role antineoplastic agent (CHEBI:35610) |
| sugiol (CHEBI:138961) has role antioxidant (CHEBI:22586) |
| sugiol (CHEBI:138961) has role antiviral agent (CHEBI:22587) |
| sugiol (CHEBI:138961) has role plant metabolite (CHEBI:76924) |
| sugiol (CHEBI:138961) has role radical scavenger (CHEBI:48578) |
| sugiol (CHEBI:138961) is a abietane diterpenoid (CHEBI:36762) |
| sugiol (CHEBI:138961) is a carbotricyclic compound (CHEBI:38032) |
| sugiol (CHEBI:138961) is a cyclic terpene ketone (CHEBI:36130) |
| sugiol (CHEBI:138961) is a meroterpenoid (CHEBI:64419) |
| sugiol (CHEBI:138961) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| 11-hydroxysugiol (CHEBI:138962) has functional parent sugiol (CHEBI:138961) |
| IUPAC Name |
|---|
| 12-hydroxyabieta-8,11,13-trien-7-one |
| Synonym | Source |
|---|---|
| (+)-sugiol | ChEBI |
| UniProt Name | Source |
|---|---|
| sugiol | UniProt |
| Citations |
|---|