EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O2 |
| Net Charge | 0 |
| Average Mass | 300.442 |
| Monoisotopic Mass | 300.20893 |
| SMILES | [H][C@@]12CC(=O)c3cc(C(C)C)c(O)cc3[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H28O2/c1-12(2)13-9-14-15(10-16(13)21)20(5)8-6-7-19(3,4)18(20)11-17(14)22/h9-10,12,18,21H,6-8,11H2,1-5H3/t18-,20+/m0/s1 |
| InChIKey | IPEHJNRNYPOFII-AZUAARDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calocedrus formosana (ncbitaxon:54798) | bark (BTO:0001301) | PubMed (15856404) | |
| Celastrus orbiculatus (ncbitaxon:85181) | root (BTO:0001188) | PubMed (24134003) | |
| Cephalotaxus lanceolata (ncbitaxon:450881) | |||
| twig (BTO:0000713) | PubMed (28399666) | ||
| leaf (BTO:0000713) | PubMed (28399666) | ||
| Cryptomeria japonica (ncbitaxon:3369) | bark (BTO:0001301) | PubMed (IND500669066) | |
| Isodon rugosus (ncbitaxon:204135) | - | PubMed (27458379) | |
| Juniperus procera (ncbitaxon:62753) | - | PubMed (22459455) | petroleum ether fraction |
| Metasequoia glyptostroboides (ncbitaxon:3371) | - | PubMed (27383486) | |
| Salvia castanea (ncbitaxon:476450) | - | PubMed (23019884) | |
| Salvia leriifolia (ncbitaxon:1933732) | - | PubMed (22174076) |
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sugiol (CHEBI:138961) has functional parent ferruginol (CHEBI:78274) |
| sugiol (CHEBI:138961) has role antineoplastic agent (CHEBI:35610) |
| sugiol (CHEBI:138961) has role antioxidant (CHEBI:22586) |
| sugiol (CHEBI:138961) has role antiviral agent (CHEBI:22587) |
| sugiol (CHEBI:138961) has role plant metabolite (CHEBI:76924) |
| sugiol (CHEBI:138961) has role radical scavenger (CHEBI:48578) |
| sugiol (CHEBI:138961) is a abietane diterpenoid (CHEBI:36762) |
| sugiol (CHEBI:138961) is a carbotricyclic compound (CHEBI:38032) |
| sugiol (CHEBI:138961) is a cyclic terpene ketone (CHEBI:36130) |
| sugiol (CHEBI:138961) is a meroterpenoid (CHEBI:64419) |
| sugiol (CHEBI:138961) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| 11-hydroxysugiol (CHEBI:138962) has functional parent sugiol (CHEBI:138961) |
| IUPAC Name |
|---|
| 12-hydroxyabieta-8,11,13-trien-7-one |
| Synonym | Source |
|---|---|
| (+)-sugiol | ChEBI |
| UniProt Name | Source |
|---|---|
| sugiol | UniProt |
| Citations |
|---|