EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@@]12CCc3cc(C(C)C)c(O)cc3[C@@]1(C)C[C@H](O)CC2(C)C |
| InChI | InChI=1S/C20H30O2/c1-12(2)15-8-13-6-7-18-19(3,4)10-14(21)11-20(18,5)16(13)9-17(15)22/h8-9,12,14,18,21-22H,6-7,10-11H2,1-5H3/t14-,18+,20-/m1/s1 |
| InChIKey | PRYXPGFZVGZNBL-HEFCMCLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fraxinus sieboldiana (ncbitaxon:490850) | stem (BTO:0001300) | PubMed (20961093) | Previous component: stem bark; EtOAc soluble fraction of 95% ethanolic extract of air-dried stem bark |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6β-hydroxyferruginol (CHEBI:70577) has functional parent ferruginol (CHEBI:78274) |
| 6β-hydroxyferruginol (CHEBI:70577) has role plant metabolite (CHEBI:76924) |
| 6β-hydroxyferruginol (CHEBI:70577) is a carbotricyclic compound (CHEBI:38032) |
| 6β-hydroxyferruginol (CHEBI:70577) is a meroterpenoid (CHEBI:64419) |
| 6β-hydroxyferruginol (CHEBI:70577) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2β)-abieta-8,11,13-triene-2,12-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21097458 | Reaxys |
| Citations |
|---|