EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | [H][C@@]12CCc3cc(C(C)C)c(O)c(O)c3[C@@]1(CO)CCCC2(C)C |
| InChI | InChI=1S/C20H30O3/c1-12(2)14-10-13-6-7-15-19(3,4)8-5-9-20(15,11-21)16(13)18(23)17(14)22/h10,12,15,21-23H,5-9,11H2,1-4H3/t15-,20+/m0/s1 |
| InChIKey | ZBPGOZPDUZTLRB-MGPUTAFESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia mellifera (ncbitaxon:392671) | aerial part (BTO:0001658) | Article (Phytochemistry, 1991, 30(12), 4067-4070) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11,20-dihydroxyferruginol (CHEBI:138965) has functional parent ferruginol (CHEBI:78274) |
| 11,20-dihydroxyferruginol (CHEBI:138965) has role plant metabolite (CHEBI:76924) |
| 11,20-dihydroxyferruginol (CHEBI:138965) is a abietane diterpenoid (CHEBI:36762) |
| 11,20-dihydroxyferruginol (CHEBI:138965) is a carbotricyclic compound (CHEBI:38032) |
| 11,20-dihydroxyferruginol (CHEBI:138965) is a catechols (CHEBI:33566) |
| 11,20-dihydroxyferruginol (CHEBI:138965) is a meroterpenoid (CHEBI:64419) |
| 11,20-dihydroxyferruginol (CHEBI:138965) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| 11,20-dihydroxysugiol (CHEBI:138963) has functional parent 11,20-dihydroxyferruginol (CHEBI:138965) |
| IUPAC Name |
|---|
| abieta-8,11,13-triene-11,12,20-triol |
| UniProt Name | Source |
|---|---|
| 11,20-dihydroxyferruginol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20271 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5349789 | Reaxys |
| Citations |
|---|