EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25FNO4.Na |
| Net Charge | 0 |
| Average Mass | 433.455 |
| Monoisotopic Mass | 433.16653 |
| SMILES | CC(C)n1c(/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])c(-c2ccc(F)cc2)c2ccccc21.[Na+] |
| InChI | InChI=1S/C24H26FNO4.Na/c1-15(2)26-21-6-4-3-5-20(21)24(16-7-9-17(25)10-8-16)22(26)12-11-18(27)13-19(28)14-23(29)30;/h3-12,15,18-19,27-28H,13-14H2,1-2H3,(H,29,30);/q;+1/p-1/b12-11+;/t18-,19-;/m1./s1 |
| InChIKey | ZGGHKIMDNBDHJB-NRFPMOEYSA-M |
| Roles Classification |
|---|
| Biological Role: | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Application: | anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,5S)-fluvastatin sodium (CHEBI:77602) has part (3R,5S)-fluvastatin(1−) (CHEBI:77600) |
| (3R,5S)-fluvastatin sodium (CHEBI:77602) is a organic sodium salt (CHEBI:38700) |
| (3R,5S)-fluvastatin sodium (CHEBI:77602) is a statin (synthetic) (CHEBI:87635) |
| (3R,5S)-fluvastatin sodium (CHEBI:77602) is enantiomer of (3S,5R)-fluvastatin sodium (CHEBI:77603) |
| Incoming Relation(s) |
| fluvastatin sodium (CHEBI:5137) has part (3R,5S)-fluvastatin sodium (CHEBI:77602) |
| (3S,5R)-fluvastatin sodium (CHEBI:77603) is enantiomer of (3R,5S)-fluvastatin sodium (CHEBI:77602) |
| IUPAC Name |
|---|
| sodium (3R,5S,6E)-7-[3-(4-fluorophenyl)-1-isopropyl-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoate |
| Synonyms | Source |
|---|---|
| (+)-(3R,5S)-fluvastatin sodium | ChEBI |
| (3R,5S)-(+)-fluvastatin sodium | ChEBI |
| (+)-fluvastatin sodium | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4286607 | Reaxys |