EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O3 |
| Net Charge | 0 |
| Average Mass | 230.263 |
| Monoisotopic Mass | 230.09429 |
| SMILES | COc1ccc2cc([C@H](C)C(=O)O)ccc2c1 |
| InChI | InChI=1S/C14H14O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | CMWTZPSULFXXJA-VIFPVBQESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. drug allergen Any drug which causes the onset of an allergic reaction. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. drug allergen Any drug which causes the onset of an allergic reaction. gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naproxen (CHEBI:7476) has role antipyretic (CHEBI:35493) |
| naproxen (CHEBI:7476) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| naproxen (CHEBI:7476) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| naproxen (CHEBI:7476) has role drug allergen (CHEBI:88188) |
| naproxen (CHEBI:7476) has role environmental contaminant (CHEBI:78298) |
| naproxen (CHEBI:7476) has role gout suppressant (CHEBI:35845) |
| naproxen (CHEBI:7476) has role non-narcotic analgesic (CHEBI:35481) |
| naproxen (CHEBI:7476) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| naproxen (CHEBI:7476) has role xenobiotic (CHEBI:35703) |
| naproxen (CHEBI:7476) is a methoxynaphthalene (CHEBI:48851) |
| naproxen (CHEBI:7476) is a monocarboxylic acid (CHEBI:25384) |
| naproxen (CHEBI:7476) is conjugate acid of naproxen(1−) (CHEBI:59527) |
| Incoming Relation(s) |
| desmethylnaproxen sulfate (CHEBI:133458) has functional parent naproxen (CHEBI:7476) |
| naproxcinod (CHEBI:76254) has functional parent naproxen (CHEBI:7476) |
| naproxen(1−) (CHEBI:59527) is conjugate base of naproxen (CHEBI:7476) |
| IUPAC Name |
|---|
| (2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid |
| INNs | Source |
|---|---|
| naproxen | DrugBank |
| naproxene | ChemIDplus |
| naproxeno | ChemIDplus |
| naproxenum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (+)-2-(6-Methoxy-2-naphthyl)propionic acid | ChemIDplus |
| (+)-2-(Methoxy-2-naphthyl)-propionic acid | ChemIDplus |
| (+)-2-(Methoxy-2-naphthyl)-propionsäure | ChemIDplus |
| (+)-(S)-6-Methoxy-α-methyl-2-naphthaleneacetic acid | ChemIDplus |
| naproxen | ChEMBL |
| (+)-Naproxen | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3591067 | Beilstein |
| CAS:22204-53-1 | KEGG COMPOUND |
| CAS:22204-53-1 | ChemIDplus |
| Citations |
|---|