EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7476 - naproxen
| Formula | C14H14O3 |
| Net Charge | 0 |
| Average Mass | 230.263 |
| Monoisotopic Mass | 230.09429 |
| SMILES | COc1ccc2cc([C@H](C)C(=O)O)ccc2c1 |
| InChI | InChI=1S/C14H14O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | CMWTZPSULFXXJA-VIFPVBQESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| Applications: | gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. drug allergen Any drug which causes the onset of an allergic reaction. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naproxen (CHEBI:7476) has role antipyretic (CHEBI:35493) |
| naproxen (CHEBI:7476) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| naproxen (CHEBI:7476) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| naproxen (CHEBI:7476) has role drug allergen (CHEBI:88188) |
| naproxen (CHEBI:7476) has role environmental contaminant (CHEBI:78298) |
| naproxen (CHEBI:7476) has role gout suppressant (CHEBI:35845) |
| naproxen (CHEBI:7476) has role non-narcotic analgesic (CHEBI:35481) |
| naproxen (CHEBI:7476) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| naproxen (CHEBI:7476) has role xenobiotic (CHEBI:35703) |
| naproxen (CHEBI:7476) is a methoxynaphthalene (CHEBI:48851) |
| naproxen (CHEBI:7476) is a monocarboxylic acid (CHEBI:25384) |
| naproxen (CHEBI:7476) is conjugate acid of naproxen(1−) (CHEBI:59527) |
| Incoming Relation(s) |
| desmethylnaproxen sulfate (CHEBI:133458) has functional parent naproxen (CHEBI:7476) |
| naproxcinod (CHEBI:76254) has functional parent naproxen (CHEBI:7476) |
| naproxen(1−) (CHEBI:59527) is conjugate base of naproxen (CHEBI:7476) |
| IUPAC Name |
|---|
| (2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid |
| INNs | Source |
|---|---|
| naproxeno | ChemIDplus |
| naproxene | ChemIDplus |
| naproxenum | ChemIDplus |
| naproxen | DrugBank |
| Synonyms | Source |
|---|---|
| Naproxen | KEGG COMPOUND |
| naproxen | ChEMBL |
| (+)-(S)-6-Methoxy-α-methyl-2-naphthaleneacetic acid | ChemIDplus |
| (+)-2-(6-Methoxy-2-naphthyl)propionic acid | ChemIDplus |
| (+)-Naproxen | ChemIDplus |
| (+)-2-(Methoxy-2-naphthyl)-propionsäure | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3591067 | Beilstein |
| CAS:22204-53-1 | KEGG COMPOUND |
| CAS:22204-53-1 | ChemIDplus |
| Citations |
|---|