EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO6 |
| Net Charge | 0 |
| Average Mass | 347.367 |
| Monoisotopic Mass | 347.13689 |
| SMILES | COc1ccc2cc([C@H](C)C(=O)OCCCCO[N+](=O)[O-])ccc2c1 |
| InChI | InChI=1S/C18H21NO6/c1-13(18(20)24-9-3-4-10-25-19(21)22)14-5-6-16-12-17(23-2)8-7-15(16)11-14/h5-8,11-13H,3-4,9-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | AKFJWRDCWYYTIG-ZDUSSCGKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | nitric oxide donor An agent, with unique chemical structure and biochemical requirements, which generates nitric oxide. |
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naproxcinod (CHEBI:76254) has functional parent butane-1,4-diol (CHEBI:41189) |
| naproxcinod (CHEBI:76254) has functional parent naproxen (CHEBI:7476) |
| naproxcinod (CHEBI:76254) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| naproxcinod (CHEBI:76254) has role nitric oxide donor (CHEBI:50566) |
| naproxcinod (CHEBI:76254) has role non-narcotic analgesic (CHEBI:35481) |
| naproxcinod (CHEBI:76254) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| naproxcinod (CHEBI:76254) has role prodrug (CHEBI:50266) |
| naproxcinod (CHEBI:76254) is a carboxylic ester (CHEBI:33308) |
| naproxcinod (CHEBI:76254) is a methoxynaphthalene (CHEBI:48851) |
| naproxcinod (CHEBI:76254) is a nitrate ester (CHEBI:51080) |
| IUPAC Name |
|---|
| 4-(nitrooxy)butyl (2S)-2-(6-methoxy-2-naphthyl)propanoate |
| INNs | Source |
|---|---|
| naproxcinod | WHO MedNet |
| naproxcinod | WHO MedNet |
| naproxcinod | KEGG DRUG |
| naproxcinodum | WHO MedNet |
| Synonyms | Source |
|---|---|
| AR-P900758XX | ChEMBL |
| AZD 3582 | ChemIDplus |
| AZD-3582 | ChEMBL |
| AZD3582 | ChemIDplus |
| HCT 3012 | ChemIDplus |
| HCT-3012 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4674 | DrugCentral |
| D09568 | KEGG DRUG |
| Naproxcinod | Wikipedia |
| US2008269323 | Patent |
| WO2009000723 | Patent |
| WO2012152438 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8432594 | Reaxys |
| CAS:163133-43-5 | ChemIDplus |
| Citations |
|---|