EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13O3 |
| Net Charge | -1 |
| Average Mass | 229.255 |
| Monoisotopic Mass | 229.08702 |
| SMILES | COc1ccc2cc([C@H](C)C(=O)[O-])ccc2c1 |
| InChI | InChI=1S/C14H14O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3,(H,15,16)/p-1/t9-/m0/s1 |
| InChIKey | CMWTZPSULFXXJA-VIFPVBQESA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naproxen(1−) (CHEBI:59527) is a monocarboxylic acid anion (CHEBI:35757) |
| naproxen(1−) (CHEBI:59527) is conjugate base of naproxen (CHEBI:7476) |
| Incoming Relation(s) |
| naproxen sodium (CHEBI:7477) has part naproxen(1−) (CHEBI:59527) |
| naproxen (CHEBI:7476) is conjugate acid of naproxen(1−) (CHEBI:59527) |
| IUPAC Name |
|---|
| (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| Synonym | Source |
|---|---|
| naproxen | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4461309 | Beilstein |