EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O6S |
| Net Charge | 0 |
| Average Mass | 296.300 |
| Monoisotopic Mass | 296.03546 |
| SMILES | C[C@H](C(=O)O)c1ccc2cc(OS(=O)(=O)O)ccc2c1 |
| InChI | InChI=1S/C13H12O6S/c1-8(13(14)15)9-2-3-11-7-12(19-20(16,17)18)5-4-10(11)6-9/h2-8H,1H3,(H,14,15)(H,16,17,18)/t8-/m0/s1 |
| InChIKey | BNKMSCMOWGCUOF-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cunninghamella echinulata (ncbitaxon:76405) | - | PubMed (12740180) | Strain: AS 3.2004 |
| Cunninghamella blakeslesna (ncbitaxon:155726) | - | PubMed (12740180) | Strain: AS 3.153 |
| Cunninghamella elegans (ncbitaxon:4853) | - | PubMed (12740180) | Strain: AS 3.156 |
| Homo sapiens (ncbitaxon:9606) | plasma (UBERON:0001969) | PubMed (2566468) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungal xenobiotic metabolite Any fungal metabolite produced by metabolism of a xenobiotic compound in fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desmethylnaproxen sulfate (CHEBI:133458) has functional parent naproxen (CHEBI:7476) |
| desmethylnaproxen sulfate (CHEBI:133458) has role drug metabolite (CHEBI:49103) |
| desmethylnaproxen sulfate (CHEBI:133458) has role fungal xenobiotic metabolite (CHEBI:76968) |
| desmethylnaproxen sulfate (CHEBI:133458) is a aryl sulfate (CHEBI:37919) |
| desmethylnaproxen sulfate (CHEBI:133458) is a monocarboxylic acid (CHEBI:25384) |
| desmethylnaproxen sulfate (CHEBI:133458) is a naphthalenes (CHEBI:25477) |
| desmethylnaproxen sulfate (CHEBI:133458) is conjugate acid of desmethylnaproxen sulfate anion (CHEBI:133459) |
| Incoming Relation(s) |
| desmethylnaproxen sulfate anion (CHEBI:133459) is conjugate base of desmethylnaproxen sulfate (CHEBI:133458) |
| IUPAC Name |
|---|
| (2S)-2-[6-(sulfooxy)naphthalen-2-yl]propanoic acid |
| Synonyms | Source |
|---|---|
| Desmethylnaproxen-6-O-sulfate | ChemIDplus |
| O-desmethylnaproxen sulfate | ChEBI |
| 6-desmethylnaproxen sulfate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:69391-09-9 | ChemIDplus |
| Citations |
|---|