EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H8O3 |
| Net Charge | 0 |
| Average Mass | 236.226 |
| Monoisotopic Mass | 236.04734 |
| SMILES | O=c1oc2ccccc2c2oc3ccccc3c12 |
| InChI | InChI=1S/C15H8O3/c16-15-13-9-5-1-3-7-11(9)17-14(13)10-6-2-4-8-12(10)18-15/h1-8H |
| InChIKey | JBIZUYWOIKFETJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coumestan (CHEBI:72578) has role phytoestrogen (CHEBI:76989) |
| coumestan (CHEBI:72578) has role plant metabolite (CHEBI:76924) |
| coumestan (CHEBI:72578) is a coumestans (CHEBI:72577) |
| coumestan (CHEBI:72578) is a δ-lactone (CHEBI:18946) |
| Incoming Relation(s) |
| coumestrol (CHEBI:3908) has functional parent coumestan (CHEBI:72578) |
| glycyrol (CHEBI:80832) has functional parent coumestan (CHEBI:72578) |
| psoralidin (CHEBI:8616) has functional parent coumestan (CHEBI:72578) |
| sojagol (CHEBI:9183) has functional parent coumestan (CHEBI:72578) |
| wedelolactone (CHEBI:10037) has functional parent coumestan (CHEBI:72578) |
| IUPAC Name |
|---|
| 6H-[1]benzofuro[3,2-c]chromen-6-one |
| Synonyms | Source |
|---|---|
| Benzofurano(3',2':3,4)coumarin | ChemIDplus |
| 6H-Benzofuro(3,2-c)(1)benzopyran-6-one | ChemIDplus |
| Citations |
|---|