EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O5 |
| Net Charge | 0 |
| Average Mass | 336.343 |
| Monoisotopic Mass | 336.09977 |
| SMILES | CC(C)=CCc1cc2c(cc1O)oc(=O)c1c3ccc(O)cc3oc21 |
| InChI | InChI=1S/C20H16O5/c1-10(2)3-4-11-7-14-17(9-15(11)22)25-20(23)18-13-6-5-12(21)8-16(13)24-19(14)18/h3,5-9,21-22H,4H2,1-2H3 |
| InChIKey | YABIJLLNNFURIJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cullen corylifolium (ncbitaxon:429560) | - | PubMed (24507928) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. estrogen receptor agonist An agonist at the estrogen receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| psoralidin (CHEBI:8616) has functional parent coumestan (CHEBI:72578) |
| psoralidin (CHEBI:8616) has role estrogen receptor agonist (CHEBI:63951) |
| psoralidin (CHEBI:8616) has role plant metabolite (CHEBI:76924) |
| psoralidin (CHEBI:8616) is a coumestans (CHEBI:72577) |
| psoralidin (CHEBI:8616) is a polyphenol (CHEBI:26195) |
| psoralidin (CHEBI:8616) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 3,9-dihydroxy-2-(3-methylbut-2-en-1-yl)-6H-[1]benzofuro[3,2-c][1]benzopyran-6-one |
| Synonym | Source |
|---|---|
| 3,9-Dihydroxy-2-prenylcoumestan | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C10523 | KEGG COMPOUND |
| C00002566 | KNApSAcK |
| LMPK12090007 | LIPID MAPS |
| HMDB0034050 | HMDB |
| Psoralidin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:320069 | Reaxys |
| CAS:18642-23-4 | KEGG COMPOUND |
| CAS:18642-23-4 | ChemIDplus |
| Citations |
|---|