EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O5 |
| Net Charge | 0 |
| Average Mass | 336.343 |
| Monoisotopic Mass | 336.09977 |
| SMILES | CC1(C)CCc2c(ccc3c2oc2c4ccc(O)cc4oc(=O)c32)O1 |
| InChI | InChI=1S/C20H16O5/c1-20(2)8-7-12-14(25-20)6-5-13-16-18(24-17(12)13)11-4-3-10(21)9-15(11)23-19(16)22/h3-6,9,21H,7-8H2,1-2H3 |
| InChIKey | GSAVLDZAGYKJSO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | - | PubMed (16659156) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sojagol (CHEBI:9183) has functional parent coumestan (CHEBI:72578) |
| sojagol (CHEBI:9183) has role plant metabolite (CHEBI:76924) |
| sojagol (CHEBI:9183) is a coumestans (CHEBI:72577) |
| sojagol (CHEBI:9183) is a phenols (CHEBI:33853) |
| sojagol (CHEBI:9183) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 10-hydroxy-3,3-dimethyl-2,3-dihydro-1H,7H-pyrano[2',3':6,7][1]benzofuro[3,2-c][1]benzopyran-7-one |
| Manual Xrefs | Databases |
|---|---|
| C00002572 | KNApSAcK |
| C10529 | KEGG COMPOUND |
| HMDB0034027 | HMDB |
| LMPK12090012 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1628647 | Reaxys |
| CAS:18979-00-5 | KEGG COMPOUND |
| CAS:18979-00-5 | ChemIDplus |
| Citations |
|---|