EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O6 |
| Net Charge | 0 |
| Average Mass | 366.369 |
| Monoisotopic Mass | 366.11034 |
| SMILES | COc1c(CC=C(C)C)c(O)cc2oc(=O)c3c4ccc(O)cc4oc3c12 |
| InChI | InChI=1S/C21H18O6/c1-10(2)4-6-12-14(23)9-16-18(19(12)25-3)20-17(21(24)27-16)13-7-5-11(22)8-15(13)26-20/h4-5,7-9,22-23H,6H2,1-3H3 |
| InChIKey | LWESBHWAOZORCQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | - | PubMed (25445757) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycyrol (CHEBI:80832) has functional parent coumestan (CHEBI:72578) |
| glycyrol (CHEBI:80832) has role antineoplastic agent (CHEBI:35610) |
| glycyrol (CHEBI:80832) has role plant metabolite (CHEBI:76924) |
| glycyrol (CHEBI:80832) is a aromatic ether (CHEBI:35618) |
| glycyrol (CHEBI:80832) is a coumestans (CHEBI:72577) |
| glycyrol (CHEBI:80832) is a polyphenol (CHEBI:26195) |
| glycyrol (CHEBI:80832) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 3,9-dihydroxy-1-methoxy-2-(3-methylbut-2-en-1-yl)-6H-[1]benzofuro[3,2-c][1]benzopyran-6-one |
| Synonyms | Source |
|---|---|
| Neoglycyrol | KEGG COMPOUND |
| 1,9-Dihydroxy-3-methoxy-2-prenylcoumestan | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C16968 | KEGG COMPOUND |
| C00009777 | KNApSAcK |
| LMPK12090044 | LIPID MAPS |
| HMDB0033882 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:23013-84-5 | KEGG COMPOUND |
| Citations |
|---|