EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10O7 |
| Net Charge | 0 |
| Average Mass | 314.249 |
| Monoisotopic Mass | 314.04265 |
| SMILES | COc1cc(O)c2c(c1)oc(=O)c1c3cc(O)c(O)cc3oc21 |
| InChI | InChI=1S/C16H10O7/c1-21-6-2-10(19)14-12(3-6)23-16(20)13-7-4-8(17)9(18)5-11(7)22-15(13)14/h2-5,17-19H,1H3 |
| InChIKey | XQDCKJKKMFWXGB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| wedelolactone (CHEBI:10037) has functional parent coumestan (CHEBI:72578) |
| wedelolactone (CHEBI:10037) has role antineoplastic agent (CHEBI:35610) |
| wedelolactone (CHEBI:10037) has role apoptosis inducer (CHEBI:68495) |
| wedelolactone (CHEBI:10037) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| wedelolactone (CHEBI:10037) has role hepatoprotective agent (CHEBI:62868) |
| wedelolactone (CHEBI:10037) has role metabolite (CHEBI:25212) |
| wedelolactone (CHEBI:10037) is a aromatic ether (CHEBI:35618) |
| wedelolactone (CHEBI:10037) is a coumestans (CHEBI:72577) |
| wedelolactone (CHEBI:10037) is a polyphenol (CHEBI:26195) |
| wedelolactone (CHEBI:10037) is a δ-lactone (CHEBI:18946) |
| Incoming Relation(s) |
| wedelolactone(1-) (CHEBI:747551) is conjugate base of wedelolactone (CHEBI:10037) |
| IUPAC Name |
|---|
| 1,8,9-trihydroxy-3-methoxy-6H-[1]benzofuro[3,2-c]chromen-6-one |
| Synonyms | Source |
|---|---|
| 1,8,9-trihydroxy-3-methoxycoumestan | ChEBI |
| Wedelolactone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002585 | KNApSAcK |
| C10541 | KEGG COMPOUND |
| LMPK12090046 | LIPID MAPS |
| Wedelolactone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:332398 | Reaxys |
| CAS:524-12-9 | ChemIDplus |
| CAS:524-12-9 | KEGG COMPOUND |
| Citations |
|---|