EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10O7 |
| Net Charge | 0 |
| Average Mass | 314.249 |
| Monoisotopic Mass | 314.04265 |
| SMILES | COc1cc(O)c2c(c1)oc(=O)c1c3cc(O)c(O)cc3oc21 |
| InChI | InChI=1S/C16H10O7/c1-21-6-2-10(19)14-12(3-6)23-16(20)13-7-4-8(17)9(18)5-11(7)22-15(13)14/h2-5,17-19H,1H3 |
| InChIKey | XQDCKJKKMFWXGB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| wedelolactone (CHEBI:10037) has functional parent coumestan (CHEBI:72578) |
| wedelolactone (CHEBI:10037) has role antineoplastic agent (CHEBI:35610) |
| wedelolactone (CHEBI:10037) has role apoptosis inducer (CHEBI:68495) |
| wedelolactone (CHEBI:10037) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| wedelolactone (CHEBI:10037) has role hepatoprotective agent (CHEBI:62868) |
| wedelolactone (CHEBI:10037) has role metabolite (CHEBI:25212) |
| wedelolactone (CHEBI:10037) is a aromatic ether (CHEBI:35618) |
| wedelolactone (CHEBI:10037) is a coumestans (CHEBI:72577) |
| wedelolactone (CHEBI:10037) is a polyphenol (CHEBI:26195) |
| wedelolactone (CHEBI:10037) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 1,8,9-trihydroxy-3-methoxy-6H-[1]benzofuro[3,2-c]chromen-6-one |
| Synonyms | Source |
|---|---|
| Wedelolactone | KEGG COMPOUND |
| 1,8,9-trihydroxy-3-methoxycoumestan | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10541 | KEGG COMPOUND |
| Wedelolactone | Wikipedia |
| LMPK12090046 | LIPID MAPS |
| C00002585 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:332398 | Reaxys |
| CAS:524-12-9 | KEGG COMPOUND |
| CAS:524-12-9 | ChemIDplus |
| Citations |
|---|