EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O7 |
| Net Charge | 0 |
| Average Mass | 316.265 |
| Monoisotopic Mass | 316.05830 |
| SMILES | O=c1c(CO)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C16H12O7/c17-6-9-15(22)14-12(21)4-8(18)5-13(14)23-16(9)7-1-2-10(19)11(20)3-7/h1-5,17-21H,6H2 |
| InChIKey | NWYYMLNNXGJOKK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ophioglossum pedunculosum (ncbitaxon:60874) | whole plant (BTO:0001461) | PubMed (21401115) | 75% EtOH extract of dried whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ophioglonol (CHEBI:67934) has role plant metabolite (CHEBI:76924) |
| ophioglonol (CHEBI:67934) is a hydroxy homoflavonoid (CHEBI:76405) |
| Incoming Relation(s) |
| ophioglonol 4'-O-β-D-glucopyranoside (CHEBI:67935) has functional parent ophioglonol (CHEBI:67934) |
| pedunculosumoside A (CHEBI:67873) has functional parent ophioglonol (CHEBI:67934) |
| pedunculosumoside B (CHEBI:67874) has functional parent ophioglonol (CHEBI:67934) |
| pedunculosumoside C (CHEBI:67875) has functional parent ophioglonol (CHEBI:67934) |
| pedunculosumoside D (CHEBI:67876) has functional parent ophioglonol (CHEBI:67934) |
| pedunculosumoside E (CHEBI:67877) has functional parent ophioglonol (CHEBI:67934) |
| pedunculosumoside F (CHEBI:67878) has functional parent ophioglonol (CHEBI:67934) |
| pedunculosumoside G (CHEBI:67879) has functional parent ophioglonol (CHEBI:67934) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-(hydroxymethyl)-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15768997 | Reaxys |
| Citations |
|---|