EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O12 |
| Net Charge | 0 |
| Average Mass | 546.525 |
| Monoisotopic Mass | 546.17373 |
| SMILES | CC(C)=CCc1cc(-c2oc3cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc(O)c3c(=O)c2CO)cc(O)c1O |
| InChI | InChI=1S/C27H30O12/c1-11(2)3-4-12-5-13(6-17(31)21(12)32)26-15(9-28)22(33)20-16(30)7-14(8-18(20)38-26)37-27-25(36)24(35)23(34)19(10-29)39-27/h3,5-8,19,23-25,27-32,34-36H,4,9-10H2,1-2H3/t19-,23-,24+,25-,27-/m1/s1 |
| InChIKey | TTYVGHVGKPQQDZ-ZOTWRPDGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ophioglossum pedunculosum (ncbitaxon:60874) | whole plant (BTO:0001461) | PubMed (21401115) | 75% EtOH extract of dried whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pedunculosumoside D (CHEBI:67876) has functional parent ophioglonol (CHEBI:67934) |
| pedunculosumoside D (CHEBI:67876) has role plant metabolite (CHEBI:76924) |
| pedunculosumoside D (CHEBI:67876) is a homoflavonoid glycoside (CHEBI:76404) |
| pedunculosumoside D (CHEBI:67876) is a hydroxy homoflavonoid (CHEBI:76405) |
| pedunculosumoside D (CHEBI:67876) is a monosaccharide derivative (CHEBI:63367) |
| pedunculosumoside D (CHEBI:67876) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-[3,4-dihydroxy-5-(3-methylbut-2-en-1-yl)phenyl]-5-hydroxy-3-(hydroxymethyl)-4-oxo-4H-chromen-7-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 5'-(3-methyl-2-buten-1-yl)ophioglonol 7-O-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21523323 | Reaxys |
| Citations |
|---|