EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H42O22 |
| Net Charge | 0 |
| Average Mass | 802.688 |
| Monoisotopic Mass | 802.21677 |
| SMILES | [H][C@@]1(O[C@H]2[C@H](Oc3cc(O)c4c(=O)c(CO)c(-c5ccc(O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)c(O)c5)oc4c3)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C34H42O22/c35-6-12-21(41)20-14(40)4-11(50-34-31(27(47)24(44)19(9-38)55-34)56-33-29(49)26(46)23(43)18(8-37)54-33)5-16(20)51-30(12)10-1-2-15(13(39)3-10)52-32-28(48)25(45)22(42)17(7-36)53-32/h1-5,17-19,22-29,31-40,42-49H,6-9H2/t17-,18-,19-,22-,23-,24-,25+,26+,27+,28-,29-,31-,32-,33+,34-/m1/s1 |
| InChIKey | MGXHVYURWVASGT-JGKQFCEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ophioglossum pedunculosum (ncbitaxon:60874) | whole plant (BTO:0001461) | PubMed (21401115) | 75% EtOH extract of dried whole plant |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pedunculosumoside E (CHEBI:67877) has functional parent ophioglonol (CHEBI:67934) |
| pedunculosumoside E (CHEBI:67877) has role metabolite (CHEBI:25212) |
| pedunculosumoside E (CHEBI:67877) has role plant metabolite (CHEBI:76924) |
| pedunculosumoside E (CHEBI:67877) is a homoflavonoid glycoside (CHEBI:76404) |
| pedunculosumoside E (CHEBI:67877) is a hydroxy homoflavonoid (CHEBI:76405) |
| pedunculosumoside E (CHEBI:67877) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-[4-(β-D-glucopyranosyloxy)-3-hydroxyphenyl]-5-hydroxy-3-(hydroxymethyl)-4-oxo-4H-chromen-7-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| ophioglonol 7-O-β-D-glucopyranosyl-(1→2)-β-D-glucopyranosyl-4'-O-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21523328 | Reaxys |
| Citations |
|---|